Palmatine chloride
Internal ID | 9afef1b4-827b-4dc2-89e6-1d8a0f3f7428 |
Taxonomy | Alkaloids and derivatives > Protoberberine alkaloids and derivatives |
IUPAC Name | 2,3,9,10-tetramethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium;chloride |
SMILES (Canonical) | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC(=C(C=C4CC3)OC)OC)OC.[Cl-] |
SMILES (Isomeric) | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC(=C(C=C4CC3)OC)OC)OC.[Cl-] |
InChI | InChI=1S/C21H22NO4.ClH/c1-23-18-6-5-13-9-17-15-11-20(25-3)19(24-2)10-14(15)7-8-22(17)12-16(13)21(18)26-4;/h5-6,9-12H,7-8H2,1-4H3;1H/q+1;/p-1 |
InChI Key | RLQYRXCUPVKSAW-UHFFFAOYSA-M |
Popularity | 363 references in papers |
Molecular Formula | C21H22ClNO4 |
Molecular Weight | 387.90 g/mol |
Exact Mass | 387.1237359 g/mol |
Topological Polar Surface Area (TPSA) | 40.80 Ų |
XlogP | 0.00 |
Atomic LogP (AlogP) | 0.39 |
H-Bond Acceptor | 4 |
H-Bond Donor | 0 |
Rotatable Bonds | 4 |
10605-02-4 |
Palmatine hydrochloride |
Palmatine (chloride) |
Fibrauretin |
2,3,9,10-tetramethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium chloride |
UNII-ZJ6W8881Z8 |
ZJ6W8881Z8 |
2,3,9,10-tetramethoxy-5,6-dihydroisoquinolino[3,2-a]isoquinolin-7-ium chloride |
MFCD00016656 |
NSC209407 |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.8617 | 86.17% |
Caco-2 | + | 0.9593 | 95.93% |
Blood Brain Barrier | - | 0.5000 | 50.00% |
Human oral bioavailability | + | 0.6714 | 67.14% |
Subcellular localzation | Mitochondria | 0.3867 | 38.67% |
OATP2B1 inhibitior | - | 0.8900 | 89.00% |
OATP1B1 inhibitior | + | 0.9434 | 94.34% |
OATP1B3 inhibitior | + | 0.9510 | 95.10% |
MATE1 inhibitior | - | 0.8400 | 84.00% |
OCT2 inhibitior | + | 0.5500 | 55.00% |
BSEP inhibitior | + | 0.8009 | 80.09% |
P-glycoprotein inhibitior | + | 0.7382 | 73.82% |
P-glycoprotein substrate | - | 0.5315 | 53.15% |
CYP3A4 substrate | + | 0.5318 | 53.18% |
CYP2C9 substrate | - | 0.8149 | 81.49% |
CYP2D6 substrate | - | 0.7292 | 72.92% |
CYP3A4 inhibition | - | 0.7670 | 76.70% |
CYP2C9 inhibition | - | 0.8570 | 85.70% |
CYP2C19 inhibition | - | 0.7747 | 77.47% |
CYP2D6 inhibition | + | 0.5367 | 53.67% |
CYP1A2 inhibition | - | 0.7195 | 71.95% |
CYP2C8 inhibition | + | 0.4565 | 45.65% |
CYP inhibitory promiscuity | - | 0.5239 | 52.39% |
UGT catelyzed | - | 0.0000 | 0.00% |
Carcinogenicity (binary) | - | 0.8600 | 86.00% |
Carcinogenicity (trinary) | Non-required | 0.5627 | 56.27% |
Eye corrosion | - | 0.9840 | 98.40% |
Eye irritation | - | 0.9332 | 93.32% |
Skin irritation | - | 0.7730 | 77.30% |
Skin corrosion | - | 0.9340 | 93.40% |
Ames mutagenesis | - | 0.6300 | 63.00% |
Human Ether-a-go-go-Related Gene inhibition | + | 0.6499 | 64.99% |
Micronuclear | + | 0.5600 | 56.00% |
Hepatotoxicity | - | 0.5000 | 50.00% |
skin sensitisation | - | 0.8971 | 89.71% |
Respiratory toxicity | + | 0.5667 | 56.67% |
Reproductive toxicity | + | 0.7889 | 78.89% |
Mitochondrial toxicity | + | 0.7000 | 70.00% |
Nephrotoxicity | - | 0.8572 | 85.72% |
Acute Oral Toxicity (c) | III | 0.7228 | 72.28% |
Estrogen receptor binding | + | 0.9416 | 94.16% |
Androgen receptor binding | + | 0.8055 | 80.55% |
Thyroid receptor binding | + | 0.5487 | 54.87% |
Glucocorticoid receptor binding | + | 0.8081 | 80.81% |
Aromatase binding | - | 0.8514 | 85.14% |
PPAR gamma | - | 0.5327 | 53.27% |
Honey bee toxicity | - | 0.8966 | 89.66% |
Biodegradation | - | 0.9250 | 92.50% |
Crustacea aquatic toxicity | + | 0.7200 | 72.00% |
Fish aquatic toxicity | - | 0.6039 | 60.39% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL340 | P08684 | Cytochrome P450 3A4 |
900 nM |
IC50 |
PMID: 17994701
|
CHEMBL2362978 | P43351 | DNA repair protein RAD52 homolog |
5190 nM |
AC50 |
via CMAUP
|
CHEMBL1293226 | B2RXH2 | Lysine-specific demethylase 4D-like |
28183.8 nM |
Potency |
via CMAUP
|
CHEMBL4040 | P28482 | MAP kinase ERK2 |
7.9 nM 7.9 nM |
Potency Potency |
via Super-PRED
via CMAUP |
CHEMBL1293224 | P10636 | Microtubule-associated protein tau |
17782.8 nM |
Potency |
via CMAUP
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5747 | Q92793 | CREB-binding protein | 95.33% | 95.12% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 94.37% | 91.49% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 91.85% | 93.99% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 90.73% | 89.62% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 90.04% | 92.94% |
CHEMBL2535 | P11166 | Glucose transporter | 89.84% | 98.75% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.30% | 96.09% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.85% | 94.00% |
CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 88.51% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.86% | 86.33% |
CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 86.72% | 94.03% |
CHEMBL5925 | P22413 | Ectonucleotide pyrophosphatase/phosphodiesterase family member 1 | 86.24% | 92.38% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.82% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 85.32% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 84.59% | 91.11% |
CHEMBL2056 | P21728 | Dopamine D1 receptor | 84.30% | 91.00% |
CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 82.62% | 96.67% |
CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 82.32% | 85.49% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 82.18% | 92.98% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 82.11% | 96.00% |
CHEMBL4158 | P49327 | Fatty acid synthase | 81.12% | 82.50% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 80.55% | 94.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Coptis chinensis |
Coptis deltoidea |
Coptis japonica |
Coptis teeta |
Corydalis decumbens |
Phellodendron amurense |
Phellodendron chinense |
PubChem | 73442 |
NPASS | NPC36229 |
ChEMBL | CHEMBL274189 |