Norepinephrine
| Internal ID | a94546ff-b84e-4ee4-b6bb-35ee8397e6d5 |
| Taxonomy | Benzenoids > Phenols > Benzenediols > Catechols |
| IUPAC Name | 4-[(1R)-2-amino-1-hydroxyethyl]benzene-1,2-diol |
| SMILES (Canonical) | C1=CC(=C(C=C1C(CN)O)O)O |
| SMILES (Isomeric) | C1=CC(=C(C=C1[C@H](CN)O)O)O |
| InChI | InChI=1S/C8H11NO3/c9-4-8(12)5-1-2-6(10)7(11)3-5/h1-3,8,10-12H,4,9H2/t8-/m0/s1 |
| InChI Key | SFLSHLFXELFNJZ-QMMMGPOBSA-N |
| Popularity | 138,550 references in papers |
| Molecular Formula | C8H11NO3 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.07389321 g/mol |
| Topological Polar Surface Area (TPSA) | 86.70 Ų |
| XlogP | -1.20 |
| Atomic LogP (AlogP) | 0.09 |
| H-Bond Acceptor | 4 |
| H-Bond Donor | 4 |
| Rotatable Bonds | 2 |
| L-Noradrenaline |
| Levarterenol |
| (R)-Noradrenaline |
| L-Norepinephrine |
| Arterenol |
| (-)-Norepinephrine |
| (-)-NORADRENALINE |
| (R)-Norepinephrine |
| L-arterenol |
| (-)-Arterenol |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.9891 | 98.91% |
| Caco-2 | - | 0.9041 | 90.41% |
| Blood Brain Barrier | - | 0.9000 | 90.00% |
| Human oral bioavailability | - | 0.5571 | 55.71% |
| Subcellular localzation | Mitochondria | 0.5805 | 58.05% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.9725 | 97.25% |
| OATP1B3 inhibitior | + | 0.9588 | 95.88% |
| MATE1 inhibitior | - | 0.9800 | 98.00% |
| OCT2 inhibitior | - | 1.0000 | 100.00% |
| BSEP inhibitior | - | 0.9859 | 98.59% |
| P-glycoprotein inhibitior | - | 0.9908 | 99.08% |
| P-glycoprotein substrate | - | 0.9398 | 93.98% |
| CYP3A4 substrate | - | 0.8080 | 80.80% |
| CYP2C9 substrate | - | 1.0000 | 100.00% |
| CYP2D6 substrate | + | 0.4514 | 45.14% |
| CYP3A4 inhibition | - | 0.9209 | 92.09% |
| CYP2C9 inhibition | - | 0.9675 | 96.75% |
| CYP2C19 inhibition | - | 0.9446 | 94.46% |
| CYP2D6 inhibition | - | 0.9798 | 97.98% |
| CYP1A2 inhibition | - | 0.9135 | 91.35% |
| CYP2C8 inhibition | - | 0.9138 | 91.38% |
| CYP inhibitory promiscuity | - | 0.8839 | 88.39% |
| UGT catelyzed | + | 1.0000 | 100.00% |
| Carcinogenicity (binary) | - | 0.7208 | 72.08% |
| Carcinogenicity (trinary) | Non-required | 0.6152 | 61.52% |
| Eye corrosion | - | 0.7397 | 73.97% |
| Eye irritation | - | 0.5834 | 58.34% |
| Skin irritation | - | 0.5405 | 54.05% |
| Skin corrosion | - | 0.7476 | 74.76% |
| Ames mutagenesis | - | 0.6870 | 68.70% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.7372 | 73.72% |
| Micronuclear | - | 0.6168 | 61.68% |
| Hepatotoxicity | - | 0.9125 | 91.25% |
| skin sensitisation | + | 0.7536 | 75.36% |
| Respiratory toxicity | + | 0.9333 | 93.33% |
| Reproductive toxicity | + | 0.8778 | 87.78% |
| Mitochondrial toxicity | + | 0.9875 | 98.75% |
| Nephrotoxicity | - | 0.8811 | 88.11% |
| Acute Oral Toxicity (c) | II | 0.4487 | 44.87% |
| Estrogen receptor binding | - | 0.7542 | 75.42% |
| Androgen receptor binding | - | 0.6528 | 65.28% |
| Thyroid receptor binding | - | 0.5833 | 58.33% |
| Glucocorticoid receptor binding | - | 0.5305 | 53.05% |
| Aromatase binding | - | 0.8774 | 87.74% |
| PPAR gamma | - | 0.6357 | 63.57% |
| Honey bee toxicity | - | 0.8617 | 86.17% |
| Biodegradation | - | 0.6750 | 67.50% |
| Crustacea aquatic toxicity | - | 0.6300 | 63.00% |
| Fish aquatic toxicity | - | 0.8935 | 89.35% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] |
15848.9 nM |
Potency |
via CMAUP
|
| CHEMBL229 | P35348 | Alpha-1a adrenergic receptor |
2187.76 nM 9.1 nM 9.1 nM |
EC50 EC50 EC50 |
PMID: 8831777
PMID: 26125514 via Super-PRED |
| CHEMBL232 | P35368 | Alpha-1b adrenergic receptor |
20400 nM |
Ki |
PMID: 19857969
|
| CHEMBL1867 | P08913 | Alpha-2a adrenergic receptor |
371.54 nM 66 nM 371.54 nM 371.54 nM 371.54 nM |
EC50 Ki EC50 EC50 EC50 |
PMID: 18578476
via Super-PRED PMID: 19886609 PMID: 17630725 PMID: 15566287 |
| CHEMBL1942 | P18089 | Alpha-2b adrenergic receptor |
61.66 nM 61.66 nM 61.66 nM 61.66 nM |
EC50 EC50 EC50 EC50 |
PMID: 17630725
PMID: 18578476 via Super-PRED PMID: 15566287 |
| CHEMBL1916 | P18825 | Alpha-2c adrenergic receptor |
794.33 nM 794.33 nM 794.33 nM 63 nM 794.33 nM |
EC50 EC50 EC50 Ki EC50 |
PMID: 17630725
PMID: 18578476 PMID: 19886609 via Super-PRED PMID: 15566287 |
| CHEMBL1293236 | P46063 | ATP-dependent DNA helicase Q1 |
707.9 nM 707.9 nM 3548.1 nM 2238.7 nM |
Potency Potency Potency Potency |
via CMAUP
via Super-PRED via CMAUP via CMAUP |
| CHEMBL210 | P07550 | Beta-2 adrenergic receptor |
3300 nM 96700 nM |
Ki Ki |
PMID: 27132867
PMID: 19857969 |
| CHEMBL246 | P13945 | Beta-3 adrenergic receptor |
6.3 nM 5.5 nM 5.5 nM |
EC50 EC50 EC50 |
PMID: 18083578
via Super-PRED PMID: 18083578 |
| CHEMBL1293237 | P54132 | Bloom syndrome protein |
3548.1 nM |
Potency |
via CMAUP
|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase |
794.3 nM 794.3 nM |
Potency Potency |
via CMAUP
via Super-PRED |
| CHEMBL217 | P14416 | Dopamine D2 receptor |
8.00E-05 nM |
IC50 |
PMID: 3156993
|
| CHEMBL1293224 | P10636 | Microtubule-associated protein tau |
5623.4 nM 6309.6 nM 3548.1 nM 3162.3 nM 3981.1 nM 1258.9 nM 6309.6 nM 10000 nM 7079.5 nM |
Potency Potency Potency Potency Potency Potency Potency Potency Potency |
via CMAUP
via CMAUP via CMAUP via CMAUP via CMAUP via CMAUP via CMAUP via CMAUP via CMAUP |
| CHEMBL1293235 | P02545 | Prelamin-A/C |
11.2 nM 11.2 nM |
Potency Potency |
via CMAUP
via Super-PRED |
| CHEMBL1075138 | Q9NUW8 | Tyrosyl-DNA phosphodiesterase 1 |
501.2 nM 891.3 nM 501.2 nM |
Potency Potency Potency |
via CMAUP
via CMAUP via Super-PRED |
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.75% | 96.09% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 92.70% | 99.15% |
| CHEMBL3902 | P09211 | Glutathione S-transferase Pi | 86.74% | 93.81% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.33% | 94.45% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 86.28% | 90.24% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 84.76% | 90.00% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 80.94% | 100.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 80.72% | 98.95% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 80.65% | 97.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Albizia julibrissin |
| Crataegus monogyna |
| Lathyrus oleraceus |
| Mimosa pudica |
| Murraya paniculata |
| Musa × paradisiaca |
| Phaseolus coccineus |
| Portulaca grandiflora |
| Portulaca oleracea |
| Solanum tuberosum |
| PubChem | 439260 |
| NPASS | NPC169207 |
| ChEMBL | CHEMBL1437 |
| LOTUS | LTS0169380 |
| wikiData | Q186242 |