N(1)Gly-Asn-Trp-His-Gly-Thr-Ala-Pro-Asp(1)-Trp-Phe-Phe-Asn-Tyr-Tyr-D-Trp-OH
Internal ID | 6ebed370-5a93-4986-bee4-8584e1814f04 |
Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Cyclic peptides |
IUPAC Name | (2R)-2-[[(2S)-2-[[(2S)-2-[[(2S)-4-amino-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(3S,6S,12S,15S,18S,25S,28S)-18-(2-amino-2-oxoethyl)-6-[(1R)-1-hydroxyethyl]-12-(1H-imidazol-5-ylmethyl)-15-(1H-indol-3-ylmethyl)-3-methyl-2,5,8,11,14,17,20,23,27-nonaoxo-1,4,7,10,13,16,19,22,26-nonazabicyclo[26.3.0]hentriacontane-25-carbonyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-phenylpropanoyl]amino]-3-phenylpropanoyl]amino]-4-oxobutanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
SMILES (Canonical) | CC1C(=O)N2CCCC2C(=O)NC(CC(=O)NCC(=O)NC(C(=O)NC(C(=O)NC(C(=O)NCC(=O)NC(C(=O)N1)C(C)O)CC3=CN=CN3)CC4=CNC5=CC=CC=C54)CC(=O)N)C(=O)NC(CC6=CNC7=CC=CC=C76)C(=O)NC(CC8=CC=CC=C8)C(=O)NC(CC9=CC=CC=C9)C(=O)NC(CC(=O)N)C(=O)NC(CC1=CC=C(C=C1)O)C(=O)NC(CC1=CC=C(C=C1)O)C(=O)NC(CC1=CNC2=CC=CC=C21)C(=O)O |
SMILES (Isomeric) | C[C@H]1C(=O)N2CCC[C@H]2C(=O)N[C@@H](CC(=O)NCC(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)NCC(=O)N[C@H](C(=O)N1)[C@@H](C)O)CC3=CN=CN3)CC4=CNC5=CC=CC=C54)CC(=O)N)C(=O)N[C@@H](CC6=CNC7=CC=CC=C76)C(=O)N[C@@H](CC8=CC=CC=C8)C(=O)N[C@@H](CC9=CC=CC=C9)C(=O)N[C@@H](CC(=O)N)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)N[C@H](CC1=CNC2=CC=CC=C21)C(=O)O |
InChI | InChI=1S/C103H115N23O23/c1-54-102(147)126-35-15-26-83(126)100(145)123-81(46-86(132)110-51-87(133)114-79(44-84(104)130)97(142)119-77(41-61-48-108-70-24-13-10-21-67(61)70)96(141)121-78(43-63-50-106-53-112-63)90(135)111-52-88(134)125-89(55(2)127)101(146)113-54)99(144)120-76(40-60-47-107-69-23-12-9-20-66(60)69)95(140)117-72(36-56-16-5-3-6-17-56)91(136)115-73(37-57-18-7-4-8-19-57)93(138)122-80(45-85(105)131)98(143)118-74(38-58-27-31-64(128)32-28-58)92(137)116-75(39-59-29-33-65(129)34-30-59)94(139)124-82(103(148)149)42-62-49-109-71-25-14-11-22-68(62)71/h3-14,16-25,27-34,47-50,53-55,72-83,89,107-109,127-129H,15,26,35-46,51-52H2,1-2H3,(H2,104,130)(H2,105,131)(H,106,112)(H,110,132)(H,111,135)(H,113,146)(H,114,133)(H,115,136)(H,116,137)(H,117,140)(H,118,143)(H,119,142)(H,120,144)(H,121,141)(H,122,138)(H,123,145)(H,124,139)(H,125,134)(H,148,149)/t54-,55+,72-,73-,74-,75-,76-,77-,78-,79-,80-,81-,82+,83-,89-/m0/s1 |
InChI Key | XIIPOLLCNQAOCP-RNIFMUDHSA-N |
Popularity | 41 references in papers |
Molecular Formula | C103H115N23O23 |
Molecular Weight | 2043.20 g/mol |
Exact Mass | 2042.85697184 g/mol |
Topological Polar Surface Area (TPSA) | 717.00 Ų |
XlogP | 2.00 |
Atomic LogP (AlogP) | -2.33 |
H-Bond Acceptor | 23 |
H-Bond Donor | 25 |
Rotatable Bonds | 36 |
There are no found synonyms. |
![2D Structure of N(1)Gly-Asn-Trp-His-Gly-Thr-Ala-Pro-Asp(1)-Trp-Phe-Phe-Asn-Tyr-Tyr-D-Trp-OH 2D Structure of N(1)Gly-Asn-Trp-His-Gly-Thr-Ala-Pro-Asp(1)-Trp-Phe-Phe-Asn-Tyr-Tyr-D-Trp-OH](https://plantaedb.com/storage/docs/compounds/2023/11/n1gly-asn-trp-his-gly-thr-ala-pro-asp1-trp-phe-phe-asn-tyr-tyr-d-trp-oh.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.7287 | 72.87% |
Caco-2 | - | 0.8628 | 86.28% |
Blood Brain Barrier | - | 0.9500 | 95.00% |
Human oral bioavailability | - | 0.7143 | 71.43% |
Subcellular localzation | Mitochondria | 0.5241 | 52.41% |
OATP2B1 inhibitior | - | 1.0000 | 100.00% |
OATP1B1 inhibitior | + | 0.8098 | 80.98% |
OATP1B3 inhibitior | + | 0.9329 | 93.29% |
MATE1 inhibitior | - | 0.9209 | 92.09% |
OCT2 inhibitior | - | 0.8750 | 87.50% |
BSEP inhibitior | + | 0.9645 | 96.45% |
P-glycoprotein inhibitior | + | 0.7418 | 74.18% |
P-glycoprotein substrate | + | 0.8827 | 88.27% |
CYP3A4 substrate | + | 0.7584 | 75.84% |
CYP2C9 substrate | - | 0.8035 | 80.35% |
CYP2D6 substrate | - | 0.8475 | 84.75% |
CYP3A4 inhibition | - | 0.7989 | 79.89% |
CYP2C9 inhibition | - | 0.8660 | 86.60% |
CYP2C19 inhibition | - | 0.8213 | 82.13% |
CYP2D6 inhibition | - | 0.9094 | 90.94% |
CYP1A2 inhibition | - | 0.8777 | 87.77% |
CYP2C8 inhibition | + | 0.8350 | 83.50% |
CYP inhibitory promiscuity | - | 0.6599 | 65.99% |
UGT catelyzed | + | 0.6000 | 60.00% |
Carcinogenicity (binary) | - | 0.9000 | 90.00% |
Carcinogenicity (trinary) | Non-required | 0.5940 | 59.40% |
Eye corrosion | - | 0.9915 | 99.15% |
Eye irritation | - | 0.8953 | 89.53% |
Skin irritation | - | 0.8060 | 80.60% |
Skin corrosion | - | 0.9434 | 94.34% |
Ames mutagenesis | - | 0.8154 | 81.54% |
Human Ether-a-go-go-Related Gene inhibition | + | 0.7189 | 71.89% |
Micronuclear | + | 0.8400 | 84.00% |
Hepatotoxicity | - | 0.5774 | 57.74% |
skin sensitisation | - | 0.8998 | 89.98% |
Respiratory toxicity | + | 0.8889 | 88.89% |
Reproductive toxicity | + | 0.9778 | 97.78% |
Mitochondrial toxicity | + | 0.9500 | 95.00% |
Nephrotoxicity | + | 0.5166 | 51.66% |
Acute Oral Toxicity (c) | III | 0.5859 | 58.59% |
Estrogen receptor binding | - | 0.5771 | 57.71% |
Androgen receptor binding | + | 0.7101 | 71.01% |
Thyroid receptor binding | + | 0.8272 | 82.72% |
Glucocorticoid receptor binding | + | 0.8539 | 85.39% |
Aromatase binding | + | 0.8284 | 82.84% |
PPAR gamma | + | 0.7726 | 77.26% |
Honey bee toxicity | - | 0.6441 | 64.41% |
Biodegradation | - | 0.8500 | 85.00% |
Crustacea aquatic toxicity | - | 0.7200 | 72.00% |
Fish aquatic toxicity | - | 0.3846 | 38.46% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 99.96% | 98.95% |
CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 99.66% | 97.64% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 99.61% | 83.82% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 99.42% | 85.14% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.37% | 96.09% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 99.15% | 90.20% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.66% | 91.11% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 98.62% | 90.08% |
CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 98.37% | 88.56% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 98.15% | 91.49% |
CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 97.15% | 96.31% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 96.39% | 95.89% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.92% | 95.56% |
CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 94.71% | 91.81% |
CHEMBL2093869 | P05106 | Integrin alpha-IIb/beta-3 | 94.25% | 95.42% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.17% | 94.45% |
CHEMBL255 | P29275 | Adenosine A2b receptor | 94.12% | 98.59% |
CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 93.83% | 97.23% |
CHEMBL2535 | P11166 | Glucose transporter | 93.50% | 98.75% |
CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 92.68% | 88.42% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 91.82% | 99.15% |
CHEMBL3202 | P48147 | Prolyl endopeptidase | 91.46% | 90.65% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 91.14% | 97.14% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 90.48% | 97.33% |
CHEMBL3837 | P07711 | Cathepsin L | 90.25% | 96.61% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 89.83% | 99.23% |
CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 89.68% | 98.24% |
CHEMBL5896 | O75164 | Lysine-specific demethylase 4A | 89.43% | 99.09% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 89.00% | 96.90% |
CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 88.75% | 94.66% |
CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 88.71% | 83.10% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.35% | 97.09% |
CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 87.84% | 82.38% |
CHEMBL5203 | P33316 | dUTP pyrophosphatase | 87.58% | 99.18% |
CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 87.43% | 96.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.57% | 89.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.58% | 99.17% |
CHEMBL259 | P32245 | Melanocortin receptor 4 | 85.57% | 95.38% |
CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 85.57% | 95.00% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 85.44% | 93.00% |
CHEMBL264 | Q9Y5N1 | Histamine H3 receptor | 85.31% | 91.43% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 85.17% | 93.03% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 84.67% | 95.50% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 84.37% | 91.71% |
CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 84.33% | 92.29% |
CHEMBL1795185 | Q58F21 | Bromodomain testis-specific protein | 84.15% | 89.76% |
CHEMBL321 | P14780 | Matrix metalloproteinase 9 | 83.89% | 92.12% |
CHEMBL5939 | Q9NZ08 | Endoplasmic reticulum aminopeptidase 1 | 83.75% | 100.00% |
CHEMBL4447 | Q9Y337 | Kallikrein 5 | 83.34% | 87.50% |
CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 83.25% | 96.25% |
CHEMBL6175 | Q9H3R0 | Lysine-specific demethylase 4C | 83.16% | 96.69% |
CHEMBL2803 | P43403 | Tyrosine-protein kinase ZAP-70 | 82.61% | 82.50% |
CHEMBL2096618 | P11274 | Bcr/Abl fusion protein | 82.51% | 85.83% |
CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 82.42% | 95.56% |
CHEMBL3524 | P56524 | Histone deacetylase 4 | 82.06% | 92.97% |
CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 81.36% | 98.33% |
CHEMBL1921 | P47901 | Vasopressin V1b receptor | 81.30% | 92.50% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 81.28% | 90.17% |
CHEMBL2514 | O95665 | Neurotensin receptor 2 | 81.27% | 100.00% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.89% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Bhesa paniculata |
Cephalanthus occidentalis |
Guettarda platypoda |
Neonauclea sessilifolia |
Uncaria tomentosa |
PubChem | 163106562 |
LOTUS | LTS0036524 |
wikiData | Q104916911 |