Murrayanine
| Internal ID | 8cdbd746-a2b9-4d60-806f-d59f5a662f89 |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Carbazoles |
| IUPAC Name | 1-methoxy-9H-carbazole-3-carbaldehyde |
| SMILES (Canonical) | COC1=CC(=CC2=C1NC3=CC=CC=C32)C=O |
| SMILES (Isomeric) | COC1=CC(=CC2=C1NC3=CC=CC=C32)C=O |
| InChI | InChI=1S/C14H11NO2/c1-17-13-7-9(8-16)6-11-10-4-2-3-5-12(10)15-14(11)13/h2-8,15H,1H3 |
| InChI Key | FWNZQNAJETXQPP-UHFFFAOYSA-N |
| Popularity | 36 references in papers |
| Molecular Formula | C14H11NO2 |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.078978594 g/mol |
| Topological Polar Surface Area (TPSA) | 42.10 Ų |
| XlogP | 2.80 |
| 1-Methoxy-9H-carbazole-3-carbaldehyde |
| 723-97-7 |
| 9H-Carbazole-3-carboxaldehyde, 1-methoxy- |
| 1-Methoxy-9H-carbazole-3-carboxaldehyde |
| 3NIN8IA768 |
| CHEBI:69934 |
| NSC 94931 |
| NSC-94931 |
| C09228 |
| 3-Formyl-1-methoxycarbazole |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 98.10% | 95.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.39% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.45% | 96.09% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 90.93% | 91.49% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.84% | 94.45% |
| CHEMBL2535 | P11166 | Glucose transporter | 89.04% | 98.75% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 87.70% | 96.00% |
| CHEMBL2002 | P12268 | Inosine-5'-monophosphate dehydrogenase 2 | 87.26% | 98.21% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.29% | 86.33% |
| CHEMBL240 | Q12809 | HERG | 85.06% | 89.76% |
| CHEMBL2581 | P07339 | Cathepsin D | 85.05% | 98.95% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 82.74% | 98.59% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 81.35% | 90.20% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 81.08% | 94.73% |
| CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 80.93% | 89.44% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 80.83% | 91.71% |
| CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 80.36% | 98.11% |
| CHEMBL2708 | Q16584 | Mitogen-activated protein kinase kinase kinase 11 | 80.29% | 81.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Atalantia stenocarpa |
| Clausena excavata |
| Clausena harmandiana |
| Clausena indica |
| Clausena lansium |
| Murraya euchrestifolia |
| Murraya koenigii |
| Murraya kwangsiensis |
| Murraya paniculata |
| PubChem | 96942 |
| NPASS | NPC187501 |
| ChEMBL | CHEMBL1689802 |
| LOTUS | LTS0144992 |
| wikiData | Q27104978 |