Moscatin
Internal ID | 93fd858c-69b6-452b-a91c-7c8270fb803d |
Taxonomy | Benzenoids > Phenanthrenes and derivatives > Phenanthrols |
IUPAC Name | 4-methoxyphenanthrene-2,5-diol |
SMILES (Canonical) | COC1=C2C(=CC(=C1)O)C=CC3=C2C(=CC=C3)O |
SMILES (Isomeric) | COC1=C2C(=CC(=C1)O)C=CC3=C2C(=CC=C3)O |
InChI | InChI=1S/C15H12O3/c1-18-13-8-11(16)7-10-6-5-9-3-2-4-12(17)14(9)15(10)13/h2-8,16-17H,1H3 |
InChI Key | LVOCAIKGDCMNNK-UHFFFAOYSA-N |
Popularity | 6 references in papers |
Molecular Formula | C15H12O3 |
Molecular Weight | 240.25 g/mol |
Exact Mass | 240.078644241 g/mol |
Topological Polar Surface Area (TPSA) | 49.70 Ų |
XlogP | 3.70 |
108335-06-4 |
4-methoxyphenanthrene-2,5-diol |
Plicatol B |
FUC1N75GST |
2,5-Phenanthrenediol, 4-methoxy- |
UNII-FUC1N75GST |
CHEMBL448260 |
DTXSID90148506 |
HY-N5035 |
4-methoxy-2,5-dihydroxyphenanthrene |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.61% | 91.11% |
CHEMBL2535 | P11166 | Glucose transporter | 93.99% | 98.75% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.56% | 96.09% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.51% | 94.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.10% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.70% | 95.56% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 88.72% | 90.20% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 87.23% | 96.95% |
CHEMBL2581 | P07339 | Cathepsin D | 85.50% | 98.95% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 85.08% | 91.49% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.86% | 99.17% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 83.14% | 99.15% |
CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 81.76% | 94.03% |
CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 80.66% | 100.00% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.66% | 90.00% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 80.19% | 93.99% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 80.01% | 94.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 194774 |
NPASS | NPC38017 |
ChEMBL | CHEMBL448260 |
LOTUS | LTS0127520 |
wikiData | Q18389031 |