Methyl 7-methoxy-9H-carbazole-3-carboxylate
| Internal ID | b29933a5-6edb-4a62-a696-53eb9c3235a9 |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Carbazoles |
| IUPAC Name | methyl 7-methoxy-9H-carbazole-3-carboxylate |
| SMILES (Canonical) | COC1=CC2=C(C=C1)C3=C(N2)C=CC(=C3)C(=O)OC |
| SMILES (Isomeric) | COC1=CC2=C(C=C1)C3=C(N2)C=CC(=C3)C(=O)OC |
| InChI | InChI=1S/C15H13NO3/c1-18-10-4-5-11-12-7-9(15(17)19-2)3-6-13(12)16-14(11)8-10/h3-8,16H,1-2H3 |
| InChI Key | UHYHEIKZOWURQD-UHFFFAOYSA-N |
| Popularity | 8 references in papers |
| Molecular Formula | C15H13NO3 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.08954328 g/mol |
| Topological Polar Surface Area (TPSA) | 51.30 Ų |
| XlogP | 3.20 |
| Methyl 7-methoxy-9H-carbazole-3-carboxylate |
| Clausine C (Clauszoline L) |
| SCHEMBL601713 |
| CHEMBL1173128 |
| UHYHEIKZOWURQD-UHFFFAOYSA-N |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.77% | 91.11% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 95.18% | 90.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 94.06% | 98.75% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 94.03% | 91.49% |
| CHEMBL2292 | Q13627 | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | 92.85% | 93.24% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 91.38% | 93.99% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.23% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.12% | 94.45% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.19% | 99.17% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 87.45% | 86.92% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.49% | 94.00% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 81.71% | 97.00% |
| CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 81.00% | 87.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Angelica acutiloba |
| Angelica glauca |
| Clausena excavata |
| Clausena harmandiana |
| Levisticum officinale |
| Ligusticum porteri |
| PubChem | 11817681 |
| LOTUS | LTS0156411 |
| wikiData | Q104991880 |