Lutonarin
Internal ID | e44b0acc-9f16-45b3-9199-bb1d3a56db8b |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | 2-(3,4-dihydroxyphenyl)-5-hydroxy-6-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-7-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one |
SMILES (Canonical) | C1=CC(=C(C=C1C2=CC(=O)C3=C(C(=C(C=C3O2)OC4C(C(C(C(O4)CO)O)O)O)C5C(C(C(C(O5)CO)O)O)O)O)O)O |
SMILES (Isomeric) | C1=CC(=C(C=C1C2=CC(=O)C3=C(C(=C(C=C3O2)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O)O)O)O |
InChI | InChI=1S/C27H30O16/c28-6-15-19(33)22(36)24(38)26(41-15)18-14(42-27-25(39)23(37)20(34)16(7-29)43-27)5-13-17(21(18)35)11(32)4-12(40-13)8-1-2-9(30)10(31)3-8/h1-5,15-16,19-20,22-31,33-39H,6-7H2/t15-,16-,19-,20-,22+,23+,24-,25-,26+,27-/m1/s1 |
InChI Key | OQKYVRDRDIXQMK-KETMJRJWSA-N |
Popularity | 3 references in papers |
Molecular Formula | C27H30O16 |
Molecular Weight | 610.50 g/mol |
Exact Mass | 610.15338487 g/mol |
Topological Polar Surface Area (TPSA) | 277.00 Ų |
XlogP | -2.00 |
35450-86-3 |
4H-1-Benzopyran-4-one, 2-(3,4-dihydroxyphenyl)-6-beta-D-glucopyranosyl-7-(beta-D-glucopyranosyloxy)-5-hydroxy- |
CHEMBL470327 |
DTXSID601318676 |
HY-N9585 |
AKOS040762744 |
CS-0201482 |
2-(3,4-Dihydroxyphenyl)-5-hydroxy-6-((2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl)-7-(((2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl)oxy)-4H-chromen-4-one |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.78% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 97.65% | 98.95% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 94.93% | 94.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.60% | 89.00% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 93.58% | 91.49% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 93.46% | 99.15% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 93.37% | 96.21% |
CHEMBL220 | P22303 | Acetylcholinesterase | 91.89% | 94.45% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 89.40% | 86.92% |
CHEMBL3401 | O75469 | Pregnane X receptor | 87.46% | 94.73% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.92% | 85.14% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.75% | 95.56% |
CHEMBL3194 | P02766 | Transthyretin | 85.02% | 90.71% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.69% | 86.33% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 83.50% | 83.57% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.00% | 97.09% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 81.49% | 95.78% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.36% | 90.71% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 80.67% | 97.36% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.12% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Bryonia alba |
Hordeum vulgare |
Plagiomnium cuspidatum |
Triticum aestivum |
Vellozia coronata |
PubChem | 44559810 |
LOTUS | LTS0042153 |
wikiData | Q104391954 |