Laudanosine
Internal ID | b0da9926-2e77-442c-9ae5-1467744d200e |
Taxonomy | Organoheterocyclic compounds > Isoquinolines and derivatives > Benzylisoquinolines |
IUPAC Name | 1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinoline |
SMILES (Canonical) | CN1CCC2=CC(=C(C=C2C1CC3=CC(=C(C=C3)OC)OC)OC)OC |
SMILES (Isomeric) | CN1CCC2=CC(=C(C=C2C1CC3=CC(=C(C=C3)OC)OC)OC)OC |
InChI | InChI=1S/C21H27NO4/c1-22-9-8-15-12-20(25-4)21(26-5)13-16(15)17(22)10-14-6-7-18(23-2)19(11-14)24-3/h6-7,11-13,17H,8-10H2,1-5H3 |
InChI Key | KGPAYJZAMGEDIQ-UHFFFAOYSA-N |
Popularity | 164 references in papers |
Molecular Formula | C21H27NO4 |
Molecular Weight | 357.40 g/mol |
Exact Mass | 357.19400834 g/mol |
Topological Polar Surface Area (TPSA) | 40.20 Ų |
XlogP | 3.70 |
Atomic LogP (AlogP) | 3.49 |
H-Bond Acceptor | 5 |
H-Bond Donor | 0 |
Rotatable Bonds | 6 |
DL-Laudanosine |
1699-51-0 |
(+-)-Laudanosine |
1-(3,4-dimethoxybenzyl)-6,7-dimethoxy-2-methyl-1,2,3,4-tetrahydroisoquinoline |
(R,S)-Laudanosine |
Laudanosine (R,S) |
EINECS 216-923-9 |
NSC 94267 |
5',8-Dimethoxylaudanosine hydrochloride |
1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinoline |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9591 | 95.91% |
Caco-2 | + | 0.9313 | 93.13% |
Blood Brain Barrier | + | 0.7250 | 72.50% |
Human oral bioavailability | + | 0.5857 | 58.57% |
Subcellular localzation | Mitochondria | 0.5912 | 59.12% |
OATP2B1 inhibitior | - | 1.0000 | 100.00% |
OATP1B1 inhibitior | + | 0.9533 | 95.33% |
OATP1B3 inhibitior | + | 0.9492 | 94.92% |
MATE1 inhibitior | - | 0.9600 | 96.00% |
OCT2 inhibitior | - | 0.5000 | 50.00% |
BSEP inhibitior | + | 0.7897 | 78.97% |
P-glycoprotein inhibitior | + | 0.9145 | 91.45% |
P-glycoprotein substrate | + | 0.6233 | 62.33% |
CYP3A4 substrate | + | 0.6191 | 61.91% |
CYP2C9 substrate | + | 0.7753 | 77.53% |
CYP2D6 substrate | + | 0.8760 | 87.60% |
CYP3A4 inhibition | - | 0.8309 | 83.09% |
CYP2C9 inhibition | - | 0.9071 | 90.71% |
CYP2C19 inhibition | - | 0.9025 | 90.25% |
CYP2D6 inhibition | + | 0.8932 | 89.32% |
CYP1A2 inhibition | - | 0.6068 | 60.68% |
CYP2C8 inhibition | - | 0.6862 | 68.62% |
CYP inhibitory promiscuity | - | 0.8451 | 84.51% |
UGT catelyzed | - | 0.0000 | 0.00% |
Carcinogenicity (binary) | - | 0.9900 | 99.00% |
Carcinogenicity (trinary) | Non-required | 0.6948 | 69.48% |
Eye corrosion | - | 0.9941 | 99.41% |
Eye irritation | - | 0.9709 | 97.09% |
Skin irritation | - | 0.7758 | 77.58% |
Skin corrosion | - | 0.9395 | 93.95% |
Ames mutagenesis | - | 0.7200 | 72.00% |
Human Ether-a-go-go-Related Gene inhibition | + | 0.9224 | 92.24% |
Micronuclear | - | 0.5800 | 58.00% |
Hepatotoxicity | - | 0.7625 | 76.25% |
skin sensitisation | - | 0.9050 | 90.50% |
Respiratory toxicity | + | 0.5556 | 55.56% |
Reproductive toxicity | + | 0.8444 | 84.44% |
Mitochondrial toxicity | + | 0.5250 | 52.50% |
Nephrotoxicity | - | 0.8773 | 87.73% |
Acute Oral Toxicity (c) | III | 0.8081 | 80.81% |
Estrogen receptor binding | + | 0.7009 | 70.09% |
Androgen receptor binding | - | 0.7275 | 72.75% |
Thyroid receptor binding | + | 0.6552 | 65.52% |
Glucocorticoid receptor binding | + | 0.6247 | 62.47% |
Aromatase binding | - | 0.6524 | 65.24% |
PPAR gamma | - | 0.5540 | 55.40% |
Honey bee toxicity | - | 0.8781 | 87.81% |
Biodegradation | - | 0.8750 | 87.50% |
Crustacea aquatic toxicity | + | 0.6300 | 63.00% |
Fish aquatic toxicity | + | 0.9033 | 90.33% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL3577 | P00352 | Aldehyde dehydrogenase 1A1 |
39810.7 nM |
Potency |
via CMAUP
|
CHEMBL4159 | Q99714 | Endoplasmic reticulum-associated amyloid beta-peptide-binding protein |
25118.9 nM |
Potency |
via CMAUP
|
CHEMBL1293226 | B2RXH2 | Lysine-specific demethylase 4D-like |
28183.8 nM |
Potency |
via CMAUP
|
CHEMBL4040 | P28482 | MAP kinase ERK2 |
10000 nM |
Potency |
via CMAUP
|
CHEMBL1293235 | P02545 | Prelamin-A/C |
17.8 nM 316.2 nM 17.8 nM |
Potency Potency Potency |
via Super-PRED
via Super-PRED via CMAUP |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.08% | 96.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.78% | 85.14% |
CHEMBL2581 | P07339 | Cathepsin D | 95.04% | 98.95% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 93.19% | 95.89% |
CHEMBL5747 | Q92793 | CREB-binding protein | 92.36% | 95.12% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 91.26% | 95.89% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 90.42% | 93.99% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.27% | 94.45% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.26% | 86.33% |
CHEMBL2535 | P11166 | Glucose transporter | 88.07% | 98.75% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 87.56% | 97.25% |
CHEMBL261 | P00915 | Carbonic anhydrase I | 87.16% | 96.76% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 86.63% | 92.94% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.54% | 94.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.17% | 95.56% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.07% | 90.00% |
CHEMBL5555 | O00767 | Acyl-CoA desaturase | 82.38% | 97.50% |
CHEMBL4895 | P30530 | Tyrosine-protein kinase receptor UFO | 81.81% | 90.95% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 81.74% | 89.50% |
CHEMBL3474 | P14555 | Phospholipase A2 group IIA | 81.69% | 94.05% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.70% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Berberis heteropoda |
Berberis nummularia |
Cissampelos pareira |
Guatteria amplifolia |
Papaver macrostomum |
Papaver somniferum |
Papaver somniferum subsp. setigerum |
PubChem | 15548 |
NPASS | NPC328750 |
ChEMBL | CHEMBL1407 |
LOTUS | LTS0094818 |
wikiData | Q27163429 |