Lariciresinol 4'-O-glucoside
Internal ID | 6a487ad9-ed16-4f05-ad54-7acb57c7271a |
Taxonomy | Lignans, neolignans and related compounds > Lignan glycosides |
IUPAC Name | (2S,3R,4S,5S,6R)-2-[4-[(2S,3R,4R)-4-[(4-hydroxy-3-methoxyphenyl)methyl]-3-(hydroxymethyl)oxolan-2-yl]-2-methoxyphenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
SMILES (Canonical) | COC1=C(C=CC(=C1)CC2COC(C2CO)C3=CC(=C(C=C3)OC4C(C(C(C(O4)CO)O)O)O)OC)O |
SMILES (Isomeric) | COC1=C(C=CC(=C1)C[C@H]2CO[C@@H]([C@H]2CO)C3=CC(=C(C=C3)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)OC)O |
InChI | InChI=1S/C26H34O11/c1-33-19-8-13(3-5-17(19)29)7-15-12-35-25(16(15)10-27)14-4-6-18(20(9-14)34-2)36-26-24(32)23(31)22(30)21(11-28)37-26/h3-6,8-9,15-16,21-32H,7,10-12H2,1-2H3/t15-,16-,21+,22+,23-,24+,25+,26+/m0/s1 |
InChI Key | KNFOHFRALRKTOJ-SAOYRWCPSA-N |
Popularity | 0 references in papers |
Molecular Formula | C26H34O11 |
Molecular Weight | 522.50 g/mol |
Exact Mass | 522.21011190 g/mol |
Topological Polar Surface Area (TPSA) | 168.00 Ų |
XlogP | 0.60 |
107110-16-7 |
(+)-Lariciresinol glucoside |
MEGxp0_000905 |
ACon1_001029 |
DTXSID70904223 |
AKOS040736382 |
FS-8472 |
NCGC00169743-01 |
BRD-K73037881-001-01-1 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.30% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.61% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 94.32% | 98.95% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.98% | 85.14% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.08% | 99.17% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.59% | 97.09% |
CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 91.55% | 85.49% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.30% | 95.89% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.60% | 86.33% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 87.98% | 92.94% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.89% | 95.56% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.35% | 94.45% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.33% | 89.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 86.91% | 92.62% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 86.42% | 86.92% |
CHEMBL4208 | P20618 | Proteasome component C5 | 83.99% | 90.00% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 83.40% | 97.14% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.95% | 96.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.75% | 94.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 81.65% | 94.73% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.86% | 95.89% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 80.57% | 97.33% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 80.43% | 91.49% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Asclepias subulata |
Clematis stans |
Coptis japonica |
Daphne oleoides |
Osmanthus fragrans |
PubChem | 11972395 |
LOTUS | LTS0026940 |
wikiData | Q105201107 |