Kaempferol 3-O-(6''-galloyl)-beta-D-glucopyranoside
Internal ID | 4a2ddfa6-51b4-4619-931b-bc395aa064b8 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-3-O-glycosides |
IUPAC Name | [(2R,3S,4S,5R,6S)-6-[5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl 3,4,5-trihydroxybenzoate |
SMILES (Canonical) | C1=CC(=CC=C1C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)OC4C(C(C(C(O4)COC(=O)C5=CC(=C(C(=C5)O)O)O)O)O)O)O |
SMILES (Isomeric) | C1=CC(=CC=C1C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)COC(=O)C5=CC(=C(C(=C5)O)O)O)O)O)O)O |
InChI | InChI=1S/C28H24O15/c29-12-3-1-10(2-4-12)25-26(22(36)19-14(31)7-13(30)8-17(19)41-25)43-28-24(38)23(37)21(35)18(42-28)9-40-27(39)11-5-15(32)20(34)16(33)6-11/h1-8,18,21,23-24,28-35,37-38H,9H2/t18-,21-,23+,24-,28+/m1/s1 |
InChI Key | STMNAPXMGWBZSF-OAYLZIFXSA-N |
Popularity | 3 references in papers |
Molecular Formula | C28H24O15 |
Molecular Weight | 600.50 g/mol |
Exact Mass | 600.11152005 g/mol |
Topological Polar Surface Area (TPSA) | 253.00 Ų |
XlogP | 1.30 |
56317-05-6 |
Astragalin 6''-gallate |
[(2R,3S,4S,5R,6S)-6-[5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl 3,4,5-trihydroxybenzoate |
Kaempferol-3-O-(6 inverted exclamation marka inverted exclamation marka-galloyl)-|A-glucopyranoside |
CHEMBL503183 |
DTXSID50204859 |
HY-N10776 |
AKOS040763590 |
FS-7713 |
CS-0636020 |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 99.52% | 95.64% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.40% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.58% | 89.00% |
CHEMBL3194 | P02766 | Transthyretin | 95.62% | 90.71% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 95.07% | 94.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.87% | 86.33% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 92.63% | 91.49% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.44% | 99.17% |
CHEMBL2581 | P07339 | Cathepsin D | 92.36% | 98.95% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 90.97% | 95.17% |
CHEMBL3401 | O75469 | Pregnane X receptor | 90.83% | 94.73% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 88.64% | 95.78% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 88.02% | 83.00% |
CHEMBL220 | P22303 | Acetylcholinesterase | 87.32% | 94.45% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.91% | 90.71% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.25% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 83.74% | 96.09% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 82.95% | 99.15% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.12% | 97.09% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 81.60% | 94.42% |
CHEMBL1075162 | Q13304 | Uracil nucleotide/cysteinyl leukotriene receptor | 81.58% | 80.33% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 81.08% | 92.50% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.04% | 95.89% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.73% | 99.23% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 80.25% | 94.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Eugenia hyemalis |
Pemphis acidula |
Persicaria hydropiper |
Quercus ilex |
Quercus laurifolia |
Sclerocarya birrea |
Toxicodendron sylvestre |
PubChem | 5491813 |
LOTUS | LTS0162423 |
wikiData | Q83078330 |