Isopaynantheine
Internal ID | 91fa95dc-74a1-47d6-9636-a065430dfc79 |
Taxonomy | Alkaloids and derivatives > Corynanthean-type alkaloids |
IUPAC Name | methyl (E)-2-[(2S,3R,12bR)-3-ethenyl-8-methoxy-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizin-2-yl]-3-methoxyprop-2-enoate |
SMILES (Canonical) | COC=C(C1CC2C3=C(CCN2CC1C=C)C4=C(N3)C=CC=C4OC)C(=O)OC |
SMILES (Isomeric) | CO/C=C(\[C@H]1C[C@@H]2C3=C(CCN2C[C@@H]1C=C)C4=C(N3)C=CC=C4OC)/C(=O)OC |
InChI | InChI=1S/C23H28N2O4/c1-5-14-12-25-10-9-15-21-18(7-6-8-20(21)28-3)24-22(15)19(25)11-16(14)17(13-27-2)23(26)29-4/h5-8,13-14,16,19,24H,1,9-12H2,2-4H3/b17-13+/t14-,16-,19+/m0/s1 |
InChI Key | JGZKIGWXPPFMRG-CGJCNEAHSA-N |
Popularity | 0 references in papers |
Molecular Formula | C23H28N2O4 |
Molecular Weight | 396.50 g/mol |
Exact Mass | 396.20490738 g/mol |
Topological Polar Surface Area (TPSA) | 63.80 Ų |
XlogP | 3.20 |
There are no found synonyms. |
![2D Structure of Isopaynantheine 2D Structure of Isopaynantheine](https://plantaedb.com/storage/docs/compounds/2023/07/isopaynantheine.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.21% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.73% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.12% | 95.56% |
CHEMBL2535 | P11166 | Glucose transporter | 94.29% | 98.75% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.44% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 89.74% | 98.95% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.11% | 99.23% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.71% | 86.33% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 84.68% | 97.25% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.21% | 90.71% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.92% | 91.19% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 83.79% | 93.03% |
CHEMBL5028 | O14672 | ADAM10 | 83.54% | 97.50% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.63% | 97.09% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 81.62% | 92.98% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.42% | 95.89% |
CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 81.36% | 95.56% |
CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 81.21% | 95.71% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.01% | 89.00% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 80.94% | 89.62% |
CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 80.63% | 97.50% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 80.62% | 90.20% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cryptocarya lividula |
Euphorbia pannonica |
Ixeris chinensis |
Knautia tatarica |
Mitragyna hirsuta |
Mitragyna speciosa |
Penstemon gentianoides |
Picris conyzoides |
PubChem | 101804033 |
NPASS | NPC115370 |
LOTUS | LTS0210083 |
wikiData | Q104252151 |