Isoferreirin
Internal ID | ec8e8b01-ad7b-4ccb-896d-6e10f34bbef7 |
Taxonomy | Phenylpropanoids and polyketides > Isoflavonoids > O-methylated isoflavonoids > 2-O-methylated isoflavonoids |
IUPAC Name | 5,7-dihydroxy-3-(4-hydroxy-2-methoxyphenyl)-2,3-dihydrochromen-4-one |
SMILES (Canonical) | COC1=C(C=CC(=C1)O)C2COC3=CC(=CC(=C3C2=O)O)O |
SMILES (Isomeric) | COC1=C(C=CC(=C1)O)C2COC3=CC(=CC(=C3C2=O)O)O |
InChI | InChI=1S/C16H14O6/c1-21-13-5-8(17)2-3-10(13)11-7-22-14-6-9(18)4-12(19)15(14)16(11)20/h2-6,11,17-19H,7H2,1H3 |
InChI Key | VODZWHSRITUHNI-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C16H14O6 |
Molecular Weight | 302.28 g/mol |
Exact Mass | 302.07903816 g/mol |
Topological Polar Surface Area (TPSA) | 96.20 Ų |
XlogP | 2.50 |
76656-75-2 |
4H-1-Benzopyran-4-one, 2,3-dihydro-5,7-dihydroxy-3-(4-hydroxy-2-methoxyphenyl)- |
DTXSID30997979 |
CHEBI:174882 |
LMPK12050503 |
5,7-dihydroxy-3-(4-hydroxy-2-methoxyphenyl)-2,3-dihydrochromen-4-one |
4',5,7-Trihydroxy-2'-methoxyisoflavanone |
5,7-Dihydroxy-3-(4-hydroxy-2-methoxyphenyl)-2,3-dihydro-4H-1-benzopyran-4-one |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.77% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 95.96% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.03% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.95% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.96% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.83% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.76% | 89.00% |
CHEMBL2535 | P11166 | Glucose transporter | 90.54% | 98.75% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 88.61% | 93.99% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.62% | 99.23% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.23% | 95.89% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.08% | 97.09% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.93% | 94.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 84.75% | 99.15% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 84.54% | 94.80% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.30% | 90.00% |
CHEMBL3194 | P02766 | Transthyretin | 83.91% | 90.71% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.00% | 99.17% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.95% | 91.19% |
CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 82.85% | 100.00% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 82.19% | 93.40% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.43% | 100.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.22% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Flemingia prostrata |
Phaseolus coccineus |
Phaseolus lunatus |
Uraria picta |
Vigna mungo |
PubChem | 156743 |
LOTUS | LTS0223035 |
wikiData | Q82990345 |