Isatin
Internal ID | 5cbd967d-4917-43b0-93e4-4eb988679502 |
Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Indolines |
IUPAC Name | 1H-indole-2,3-dione |
SMILES (Canonical) | C1=CC=C2C(=C1)C(=O)C(=O)N2 |
SMILES (Isomeric) | C1=CC=C2C(=C1)C(=O)C(=O)N2 |
InChI | InChI=1S/C8H5NO2/c10-7-5-3-1-2-4-6(5)9-8(7)11/h1-4H,(H,9,10,11) |
InChI Key | JXDYKVIHCLTXOP-UHFFFAOYSA-N |
Popularity | 4,206 references in papers |
Molecular Formula | C8H5NO2 |
Molecular Weight | 147.13 g/mol |
Exact Mass | 147.032028402 g/mol |
Topological Polar Surface Area (TPSA) | 46.20 Ų |
XlogP | 0.80 |
Atomic LogP (AlogP) | 0.82 |
H-Bond Acceptor | 2 |
H-Bond Donor | 1 |
Rotatable Bonds | 0 |
91-56-5 |
1H-Indole-2,3-dione |
2,3-Indolinedione |
Indoline-2,3-dione |
INDOLE-2,3-DIONE |
Isatine |
Tribulin |
Pseudoisatin |
2,3-Dioxoindoline |
2,3-Diketoindoline |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9971 | 99.71% |
Caco-2 | + | 0.8501 | 85.01% |
Blood Brain Barrier | + | 0.9879 | 98.79% |
Human oral bioavailability | + | 0.9143 | 91.43% |
Subcellular localzation | Mitochondria | 0.6368 | 63.68% |
OATP2B1 inhibitior | - | 1.0000 | 100.00% |
OATP1B1 inhibitior | + | 0.9585 | 95.85% |
OATP1B3 inhibitior | + | 0.9560 | 95.60% |
MATE1 inhibitior | - | 0.9400 | 94.00% |
OCT2 inhibitior | - | 1.0000 | 100.00% |
BSEP inhibitior | - | 0.9472 | 94.72% |
P-glycoprotein inhibitior | - | 0.9914 | 99.14% |
P-glycoprotein substrate | - | 0.9814 | 98.14% |
CYP3A4 substrate | - | 0.6538 | 65.38% |
CYP2C9 substrate | + | 0.5872 | 58.72% |
CYP2D6 substrate | - | 0.8750 | 87.50% |
CYP3A4 inhibition | - | 0.9776 | 97.76% |
CYP2C9 inhibition | - | 0.9332 | 93.32% |
CYP2C19 inhibition | - | 0.8833 | 88.33% |
CYP2D6 inhibition | - | 0.8689 | 86.89% |
CYP1A2 inhibition | + | 0.8026 | 80.26% |
CYP2C8 inhibition | - | 0.9849 | 98.49% |
CYP inhibitory promiscuity | - | 0.7789 | 77.89% |
UGT catelyzed | - | 0.0000 | 0.00% |
Carcinogenicity (binary) | - | 0.8443 | 84.43% |
Carcinogenicity (trinary) | Non-required | 0.5678 | 56.78% |
Eye corrosion | - | 0.9698 | 96.98% |
Eye irritation | + | 1.0000 | 100.00% |
Skin irritation | - | 0.7165 | 71.65% |
Skin corrosion | - | 0.9614 | 96.14% |
Ames mutagenesis | - | 0.5600 | 56.00% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.8850 | 88.50% |
Micronuclear | + | 0.7900 | 79.00% |
Hepatotoxicity | + | 0.8750 | 87.50% |
skin sensitisation | - | 0.8778 | 87.78% |
Respiratory toxicity | - | 0.5889 | 58.89% |
Reproductive toxicity | - | 0.5111 | 51.11% |
Mitochondrial toxicity | - | 0.7375 | 73.75% |
Nephrotoxicity | + | 0.8171 | 81.71% |
Acute Oral Toxicity (c) | III | 0.6196 | 61.96% |
Estrogen receptor binding | - | 0.9092 | 90.92% |
Androgen receptor binding | + | 0.5835 | 58.35% |
Thyroid receptor binding | - | 0.5452 | 54.52% |
Glucocorticoid receptor binding | - | 0.8957 | 89.57% |
Aromatase binding | - | 0.7803 | 78.03% |
PPAR gamma | - | 0.7825 | 78.25% |
Honey bee toxicity | - | 0.8480 | 84.80% |
Biodegradation | + | 0.7500 | 75.00% |
Crustacea aquatic toxicity | + | 0.6400 | 64.00% |
Fish aquatic toxicity | - | 0.7659 | 76.59% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL1951 | P21397 | Monoamine oxidase A |
40000 nM 56234.13 nM 31800 nM |
IC50 IC50 IC50 |
PMID: 20715818
PMID: 20934874 PMID: 21134756 |
CHEMBL2039 | P27338 | Monoamine oxidase B |
18750 nM 18750 nM 18750 nM 18750 nM 18750 nM 18750 nM 18750 nM |
IC50 IC50 IC50 IC50 IC50 IC50 IC50 |
PMID: 20615716
DOI: 10.1039/C0MD00014K PMID: 24746464 PMID: 23153812 PMID: 21872365 PMID: 20715818 PMID: 19926363 |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.26% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 93.44% | 98.95% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 91.78% | 94.62% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 89.59% | 82.69% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 88.90% | 94.08% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 88.55% | 93.03% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 86.46% | 91.11% |
CHEMBL3524 | P56524 | Histone deacetylase 4 | 83.55% | 92.97% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 83.54% | 94.75% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.41% | 99.23% |
CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 82.26% | 96.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Calanthe discolor |
Capparis spinosa |
Couroupita guianensis |
Isatis tinctoria |
Persicaria tinctoria |
Strobilanthes cusia |
PubChem | 7054 |
NPASS | NPC254698 |
ChEMBL | CHEMBL326294 |
LOTUS | LTS0044916 |
wikiData | Q421348 |