Tryptanthrin
Internal ID | 13826629-6e8c-42fc-96c8-58343a7a27b9 |
Taxonomy | Organoheterocyclic compounds > Diazanaphthalenes > Benzodiazines > Quinazolines > Indoloquinazolines |
IUPAC Name | indolo[2,1-b]quinazoline-6,12-dione |
SMILES (Canonical) | C1=CC=C2C(=C1)C(=O)N3C4=CC=CC=C4C(=O)C3=N2 |
SMILES (Isomeric) | C1=CC=C2C(=C1)C(=O)N3C4=CC=CC=C4C(=O)C3=N2 |
InChI | InChI=1S/C15H8N2O2/c18-13-10-6-2-4-8-12(10)17-14(13)16-11-7-3-1-5-9(11)15(17)19/h1-8H |
InChI Key | VQQVWGVXDIPORV-UHFFFAOYSA-N |
Popularity | 333 references in papers |
Molecular Formula | C15H8N2O2 |
Molecular Weight | 248.24 g/mol |
Exact Mass | 248.058577502 g/mol |
Topological Polar Surface Area (TPSA) | 49.70 Ų |
XlogP | 2.10 |
Atomic LogP (AlogP) | 1.93 |
H-Bond Acceptor | 4 |
H-Bond Donor | 0 |
Rotatable Bonds | 0 |
Indolo[2,1-b]quinazoline-6,12-dione |
13220-57-0 |
Tryptanthrine |
Couroupitine a |
TCMDC-125859 |
GNF-PF-2691 |
Indolo(2,1-b)quinazoline-6,12-dione |
C15H8N2O2 |
MFCD00012073 |
NSC 349447 |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9959 | 99.59% |
Caco-2 | + | 0.8229 | 82.29% |
Blood Brain Barrier | + | 0.9879 | 98.79% |
Human oral bioavailability | + | 0.7143 | 71.43% |
Subcellular localzation | Mitochondria | 0.7689 | 76.89% |
OATP2B1 inhibitior | - | 1.0000 | 100.00% |
OATP1B1 inhibitior | + | 0.9217 | 92.17% |
OATP1B3 inhibitior | + | 0.9509 | 95.09% |
MATE1 inhibitior | - | 1.0000 | 100.00% |
OCT2 inhibitior | - | 0.8816 | 88.16% |
BSEP inhibitior | - | 0.6346 | 63.46% |
P-glycoprotein inhibitior | - | 0.8486 | 84.86% |
P-glycoprotein substrate | - | 0.9669 | 96.69% |
CYP3A4 substrate | + | 0.5184 | 51.84% |
CYP2C9 substrate | + | 0.5905 | 59.05% |
CYP2D6 substrate | - | 0.8620 | 86.20% |
CYP3A4 inhibition | - | 0.9060 | 90.60% |
CYP2C9 inhibition | + | 0.5000 | 50.00% |
CYP2C19 inhibition | + | 0.7013 | 70.13% |
CYP2D6 inhibition | - | 0.8495 | 84.95% |
CYP1A2 inhibition | + | 0.8783 | 87.83% |
CYP2C8 inhibition | - | 0.7190 | 71.90% |
CYP inhibitory promiscuity | + | 0.5000 | 50.00% |
UGT catelyzed | - | 0.0000 | 0.00% |
Carcinogenicity (binary) | - | 0.9100 | 91.00% |
Carcinogenicity (trinary) | Non-required | 0.5017 | 50.17% |
Eye corrosion | - | 0.9878 | 98.78% |
Eye irritation | - | 0.5536 | 55.36% |
Skin irritation | - | 0.8496 | 84.96% |
Skin corrosion | - | 0.9710 | 97.10% |
Ames mutagenesis | + | 0.6500 | 65.00% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.8486 | 84.86% |
Micronuclear | + | 0.9100 | 91.00% |
Hepatotoxicity | + | 0.6500 | 65.00% |
skin sensitisation | - | 0.9389 | 93.89% |
Respiratory toxicity | + | 0.6444 | 64.44% |
Reproductive toxicity | + | 0.5889 | 58.89% |
Mitochondrial toxicity | - | 0.5375 | 53.75% |
Nephrotoxicity | + | 0.6580 | 65.80% |
Acute Oral Toxicity (c) | II | 0.5756 | 57.56% |
Estrogen receptor binding | + | 0.7432 | 74.32% |
Androgen receptor binding | - | 0.6563 | 65.63% |
Thyroid receptor binding | + | 0.6688 | 66.88% |
Glucocorticoid receptor binding | + | 0.9079 | 90.79% |
Aromatase binding | + | 0.8489 | 84.89% |
PPAR gamma | + | 0.7643 | 76.43% |
Honey bee toxicity | - | 0.9100 | 91.00% |
Biodegradation | - | 0.8750 | 87.50% |
Crustacea aquatic toxicity | + | 0.6500 | 65.00% |
Fish aquatic toxicity | - | 0.7002 | 70.02% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase |
150 nM |
IC50 |
PMID: 22819942
|
CHEMBL230 | P35354 | Cyclooxygenase-2 |
64 nM 64 nM 64 nM 64 nM |
IC50 IC50 IC50 IC50 |
PMID: 22819942
via Super-PRED PMID: 16038536 PMID: 23146282 |
CHEMBL1293299 | Q03164 | Histone-lysine N-methyltransferase MLL |
31622.8 nM |
Potency |
via CMAUP
|
CHEMBL5514 | P42858 | Huntingtin |
11220.2 nM |
Potency |
via CMAUP
|
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase |
7150 nM 53.7 nM |
IC50 IC50 |
PMID: 24099220
PMID: 24099220 |
CHEMBL1293224 | P10636 | Microtubule-associated protein tau |
17782.8 nM |
Potency |
via CMAUP
|
CHEMBL1293277 | O15118 | Niemann-Pick C1 protein |
2818.4 nM |
Potency |
via CMAUP
|
CHEMBL1293235 | P02545 | Prelamin-A/C |
354.8 nM 354.8 nM |
Potency Potency |
via Super-PRED
via CMAUP |
CHEMBL1293294 | P51151 | Ras-related protein Rab-9A |
3162.3 nM |
Potency |
via CMAUP
|
CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase |
140 nM |
IC50 |
via Super-PRED
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 97.20% | 95.56% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 96.09% | 91.49% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 95.10% | 99.23% |
CHEMBL2581 | P07339 | Cathepsin D | 94.88% | 98.95% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.18% | 85.14% |
CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 90.18% | 96.67% |
CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 89.44% | 96.25% |
CHEMBL1868 | P17948 | Vascular endothelial growth factor receptor 1 | 88.65% | 96.47% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.25% | 86.33% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.73% | 99.15% |
CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 86.48% | 80.78% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.20% | 89.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.12% | 94.00% |
CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 83.05% | 92.67% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 81.90% | 93.40% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.61% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 73549 |
NPASS | NPC207554 |
ChEMBL | CHEMBL306946 |
LOTUS | LTS0210698 |
wikiData | Q27089028 |