Hitachimycin
Internal ID | 90e5fa67-987e-443d-89d5-d3818df433e5 |
Taxonomy | Phenylpropanoids and polyketides > Macrolactams |
IUPAC Name | (2Z,4E,6E,12E)-16,20-dihydroxy-21-methoxy-3-methyl-10-phenyl-9-azabicyclo[17.3.0]docosa-2,4,6,12,19-pentaene-8,18-dione |
SMILES (Canonical) | CC1=CC2CC(C(=C2C(=O)CC(CCC=CCC(NC(=O)C=CC=C1)C3=CC=CC=C3)O)O)OC |
SMILES (Isomeric) | C/C/1=C/C2CC(C(=C2C(=O)CC(CC/C=C/CC(NC(=O)/C=C\C=C1)C3=CC=CC=C3)O)O)OC |
InChI | InChI=1S/C29H35NO5/c1-20-11-9-10-16-27(33)30-24(21-12-5-3-6-13-21)15-8-4-7-14-23(31)19-25(32)28-22(17-20)18-26(35-2)29(28)34/h3-6,8-13,16-17,22-24,26,31,34H,7,14-15,18-19H2,1-2H3,(H,30,33)/b8-4+,11-9+,16-10+,20-17- |
InChI Key | PLQKHNPZPRTISL-ITRAFUHISA-N |
Popularity | 12 references in papers |
Molecular Formula | C29H35NO5 |
Molecular Weight | 477.60 g/mol |
Exact Mass | 477.25152322 g/mol |
Topological Polar Surface Area (TPSA) | 95.90 Ų |
XlogP | 4.00 |
NSC343256 |
(2Z,4E,6E,12E)-16,20-dihydroxy-21-methoxy-3-methyl-10-phenyl-9-azabicyclo[17.3.0]docosa-2,4,6,12,19-pentaene-8,18-dione |
![2D Structure of Hitachimycin 2D Structure of Hitachimycin](https://plantaedb.com/storage/docs/compounds/2023/11/hitachimycin.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.24% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.02% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 93.74% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.32% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.18% | 95.56% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 91.95% | 99.23% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 89.99% | 94.62% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 89.41% | 93.03% |
CHEMBL2850 | P49840 | Glycogen synthase kinase-3 alpha | 87.55% | 88.84% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.08% | 86.33% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.92% | 95.89% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.63% | 90.00% |
CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 81.44% | 96.39% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.36% | 94.45% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 81.13% | 94.08% |
CHEMBL2056 | P21728 | Dopamine D1 receptor | 80.59% | 91.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cassytha filiformis |
Cissampelos capensis |
Guatteria goudotiana |
Laurus nobilis |
Neolitsea pulchella |
Ocotea acutifolia |
PubChem | 5384563 |
LOTUS | LTS0082980 |
wikiData | Q104399698 |