Harmol
Internal ID | a8d478f6-a61a-41ce-81b8-6013cb71606a |
Taxonomy | Alkaloids and derivatives > Harmala alkaloids |
IUPAC Name | 1-methyl-2,9-dihydropyrido[3,4-b]indol-7-one |
SMILES (Canonical) | CC1=C2C(=C3C=CC(=O)C=C3N2)C=CN1 |
SMILES (Isomeric) | CC1=C2C(=C3C=CC(=O)C=C3N2)C=CN1 |
InChI | InChI=1S/C12H10N2O/c1-7-12-10(4-5-13-7)9-3-2-8(15)6-11(9)14-12/h2-6,13-14H,1H3 |
InChI Key | LBBJNGFCXDOYMQ-UHFFFAOYSA-N |
Popularity | 340 references in papers |
Molecular Formula | C12H10N2O |
Molecular Weight | 198.22 g/mol |
Exact Mass | 198.079312947 g/mol |
Topological Polar Surface Area (TPSA) | 41.10 Ų |
XlogP | 0.70 |
Atomic LogP (AlogP) | 2.32 |
H-Bond Acceptor | 1 |
H-Bond Donor | 2 |
Rotatable Bonds | 0 |
487-03-6 |
1-methyl-9H-pyrido[3,4-b]indol-7-ol |
9H-Pyrido[3,4-b]indol-7-ol, 1-methyl- |
1-Methyl-9H-beta-carbolin-7-ol |
NSC 72292 |
1-methyl-2,9-dihydropyrido[3,4-b]indol-7-one |
MLS000736795 |
1-Methyl-9H-pyrido(3,4-b)indol-7-ol |
CHEMBL14285 |
7PQ075MCA6 |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 1.0000 | 100.00% |
Caco-2 | - | 0.8706 | 87.06% |
Blood Brain Barrier | + | 0.6629 | 66.29% |
Human oral bioavailability | + | 0.7000 | 70.00% |
Subcellular localzation | Mitochondria | 0.8023 | 80.23% |
OATP2B1 inhibitior | - | 1.0000 | 100.00% |
OATP1B1 inhibitior | + | 0.9112 | 91.12% |
OATP1B3 inhibitior | + | 0.9642 | 96.42% |
MATE1 inhibitior | - | 0.9600 | 96.00% |
OCT2 inhibitior | - | 0.9250 | 92.50% |
BSEP inhibitior | - | 0.5474 | 54.74% |
P-glycoprotein inhibitior | - | 0.9386 | 93.86% |
P-glycoprotein substrate | - | 0.8729 | 87.29% |
CYP3A4 substrate | - | 0.5903 | 59.03% |
CYP2C9 substrate | - | 0.5918 | 59.18% |
CYP2D6 substrate | - | 0.8477 | 84.77% |
CYP3A4 inhibition | - | 0.6463 | 64.63% |
CYP2C9 inhibition | - | 0.8796 | 87.96% |
CYP2C19 inhibition | - | 0.8992 | 89.92% |
CYP2D6 inhibition | + | 0.8932 | 89.32% |
CYP1A2 inhibition | + | 0.9106 | 91.06% |
CYP2C8 inhibition | - | 0.8732 | 87.32% |
CYP inhibitory promiscuity | - | 0.5137 | 51.37% |
UGT catelyzed | - | 0.0000 | 0.00% |
Carcinogenicity (binary) | - | 0.9423 | 94.23% |
Carcinogenicity (trinary) | Non-required | 0.5257 | 52.57% |
Eye corrosion | - | 0.9888 | 98.88% |
Eye irritation | + | 0.7175 | 71.75% |
Skin irritation | - | 0.8167 | 81.67% |
Skin corrosion | - | 0.9648 | 96.48% |
Ames mutagenesis | + | 0.8400 | 84.00% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.7143 | 71.43% |
Micronuclear | + | 0.8500 | 85.00% |
Hepatotoxicity | + | 0.6750 | 67.50% |
skin sensitisation | - | 0.9006 | 90.06% |
Respiratory toxicity | - | 0.5444 | 54.44% |
Reproductive toxicity | + | 0.5667 | 56.67% |
Mitochondrial toxicity | - | 0.5250 | 52.50% |
Nephrotoxicity | - | 0.6863 | 68.63% |
Acute Oral Toxicity (c) | III | 0.7007 | 70.07% |
Estrogen receptor binding | + | 0.8338 | 83.38% |
Androgen receptor binding | + | 0.8284 | 82.84% |
Thyroid receptor binding | + | 0.5461 | 54.61% |
Glucocorticoid receptor binding | + | 0.8752 | 87.52% |
Aromatase binding | + | 0.8231 | 82.31% |
PPAR gamma | + | 0.6289 | 62.89% |
Honey bee toxicity | - | 0.9429 | 94.29% |
Biodegradation | - | 0.9250 | 92.50% |
Crustacea aquatic toxicity | - | 0.6400 | 64.00% |
Fish aquatic toxicity | - | 0.6511 | 65.11% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] |
35481.3 nM |
Potency |
via CMAUP
|
CHEMBL3577 | P00352 | Aldehyde dehydrogenase 1A1 |
31622.8 nM 31622.8 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL2524 | P06280 | Alpha-galactosidase A |
44668.4 nM 39810.7 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL4096 | P04637 | Cellular tumor antigen p53 |
25118.9 nM |
Potency |
via CMAUP
|
CHEMBL3622 | P33261 | Cytochrome P450 2C19 |
25118.9 nM |
Potency |
via CMAUP
|
CHEMBL3397 | P11712 | Cytochrome P450 2C9 |
15848.9 nM |
Potency |
via CMAUP
|
CHEMBL289 | P10635 | Cytochrome P450 2D6 |
15848.9 nM |
Potency |
via CMAUP
|
CHEMBL340 | P08684 | Cytochrome P450 3A4 |
39810.7 nM 39810.7 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL2392 | P06746 | DNA polymerase beta |
28183.8 nM |
Potency |
via CMAUP
|
CHEMBL4376 | Q92630 | Dual-specificity tyrosine-phosphorylation regulated kinase 2 |
1500 nM |
IC50 |
PMID: 22335895
|
CHEMBL4159 | Q99714 | Endoplasmic reticulum-associated amyloid beta-peptide-binding protein |
31622.8 nM 31622.8 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL1293299 | Q03164 | Histone-lysine N-methyltransferase MLL |
8912.5 nM |
Potency |
via CMAUP
|
CHEMBL1293226 | B2RXH2 | Lysine-specific demethylase 4D-like |
28183.8 nM 35481.3 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL1293235 | P02545 | Prelamin-A/C |
7.9 nM 7.9 nM |
Potency Potency |
via Super-PRED
via CMAUP |
CHEMBL1075163 | Q8TF76 | Serine/threonine-protein kinase haspin |
770 nM 770 nM |
IC50 IC50 |
via Super-PRED
PMID: 22335895 |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.88% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 93.89% | 98.95% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 93.19% | 83.82% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.65% | 94.45% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 90.54% | 94.75% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 88.98% | 91.49% |
CHEMBL255 | P29275 | Adenosine A2b receptor | 88.45% | 98.59% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.67% | 89.00% |
CHEMBL1907 | P15144 | Aminopeptidase N | 85.14% | 93.31% |
CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 84.75% | 85.30% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 84.02% | 93.03% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 83.14% | 91.11% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.88% | 94.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 68094 |
NPASS | NPC291389 |
ChEMBL | CHEMBL486817 |
LOTUS | LTS0023194 |
wikiData | Q15411005 |