Guayadequiene
Internal ID | 99ae0a65-98ba-4117-8f65-680efcc193cc |
Taxonomy | Benzenoids > Benzene and substituted derivatives > Methoxybenzenes > Dimethoxybenzenes |
IUPAC Name | 3-(1,3-benzodioxol-5-ylmethyl)-4-[(3,4-dimethoxyphenyl)methyl]-2H-furan-5-one |
SMILES (Canonical) | COC1=C(C=C(C=C1)CC2=C(COC2=O)CC3=CC4=C(C=C3)OCO4)OC |
SMILES (Isomeric) | COC1=C(C=C(C=C1)CC2=C(COC2=O)CC3=CC4=C(C=C3)OCO4)OC |
InChI | InChI=1S/C21H20O6/c1-23-17-5-3-14(9-19(17)24-2)8-16-15(11-25-21(16)22)7-13-4-6-18-20(10-13)27-12-26-18/h3-6,9-10H,7-8,11-12H2,1-2H3 |
InChI Key | ZNFNVULJMPXOPE-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C21H20O6 |
Molecular Weight | 368.40 g/mol |
Exact Mass | 368.12598835 g/mol |
Topological Polar Surface Area (TPSA) | 63.20 Ų |
XlogP | 3.40 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 97.04% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.45% | 94.45% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 95.71% | 96.77% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.29% | 86.33% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.82% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.94% | 95.56% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 90.17% | 92.62% |
CHEMBL2535 | P11166 | Glucose transporter | 89.66% | 98.75% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 89.21% | 85.14% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.19% | 91.11% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.49% | 95.89% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 88.12% | 94.80% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.70% | 99.17% |
CHEMBL5555 | O00767 | Acyl-CoA desaturase | 87.46% | 97.50% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.48% | 94.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.97% | 95.89% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 84.59% | 93.99% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 83.29% | 95.50% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 82.47% | 90.20% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.78% | 90.00% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 80.28% | 95.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 10523042 |
NPASS | NPC115406 |
LOTUS | LTS0247294 |
wikiData | Q105380031 |