Grandinin
Internal ID | c73ed702-172e-4dd6-9d19-b3c5f2fc8d67 |
Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
IUPAC Name | (46R)-7,8,9,12,13,14,25,26,27,30,31,32,35,36,37-pentadecahydroxy-46-[(3R,4S)-2,3,4-trihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3,18,21,41,43-pentaoxanonacyclo[27.13.3.138,42.02,20.05,10.011,16.023,28.033,45.034,39]hexatetraconta-5,7,9,11,13,15,23,25,27,29(45),30,32,34(39),35,37-pentadecaene-4,17,22,40,44-pentone |
SMILES (Canonical) | C1C2C(C3C4C(C5=C(C(=C(C(=C5C(=O)O4)C6=C(C(=C(C(=C6C(=O)O3)C7=C(C(=C(C=C7C(=O)O2)O)O)O)O)O)O)O)O)O)C8(C(C(C(O8)CO)O)O)O)OC(=O)C9=CC(=C(C(=C9C2=C(C(=C(C=C2C(=O)O1)O)O)O)O)O)O |
SMILES (Isomeric) | C1C2C(C3C4[C@@H](C5=C(C(=C(C(=C5C(=O)O4)C6=C(C(=C(C(=C6C(=O)O3)C7=C(C(=C(C=C7C(=O)O2)O)O)O)O)O)O)O)O)O)C8([C@@H]([C@@H](C(O8)CO)O)O)O)OC(=O)C9=CC(=C(C(=C9C2=C(C(=C(C=C2C(=O)O1)O)O)O)O)O)O |
InChI | InChI=1S/C46H34O30/c47-4-12-27(54)40(64)46(70,76-12)23-22-21-19(33(60)36(63)34(22)61)18-20-17(31(58)35(62)32(18)59)16-8(3-11(50)26(53)30(16)57)42(66)72-13-5-71-41(65)6-1-9(48)24(51)28(55)14(6)15-7(2-10(49)25(52)29(15)56)43(67)73-37(13)39(75-44(20)68)38(23)74-45(21)69/h1-3,12-13,23,27,37-40,47-64,70H,4-5H2/t12?,13?,23-,27-,37?,38?,39?,40-,46?/m1/s1 |
InChI Key | GCEXRPOQEVIITL-XJDSPLDHSA-N |
Popularity | 7 references in papers |
Molecular Formula | C46H34O30 |
Molecular Weight | 1066.70 g/mol |
Exact Mass | 1066.11348966 g/mol |
Topological Polar Surface Area (TPSA) | 525.00 Ų |
XlogP | -0.50 |
115166-32-0 |
(46R)-7,8,9,12,13,14,25,26,27,30,31,32,35,36,37-Pentadecahydroxy-46-[(3R,4S)-2,3,4-trihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3,18,21,41,43-pentaoxanonacyclo[27.13.3.138,42.02,20.05,10.011,16.023,28.033,45.034,39]hexatetraconta-5,7,9,11,13,15,23,25,27,29(45),30,32,34(39),35,37-pentadecaene-4,17,22,40,44-pentone |
GTPL12436 |
DTXSID101029292 |
Q5595443 |
pentadecahydroxy-[(3R,4S)-2,3,4-trihydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl][?]pentone |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.58% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 92.70% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.91% | 89.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.86% | 94.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.08% | 95.56% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.38% | 100.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.42% | 95.89% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 87.18% | 91.49% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.90% | 96.09% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 85.40% | 96.61% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 85.35% | 96.21% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.19% | 85.14% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.72% | 97.09% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 84.44% | 91.71% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 83.93% | 99.15% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 83.18% | 93.03% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 83.18% | 95.17% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.40% | 86.33% |
CHEMBL4530 | P00488 | Coagulation factor XIII | 82.07% | 96.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.72% | 92.62% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 80.52% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Castanea mollissima |
Melaleuca leucadendra |
Melaleuca quinquenervia |
Psidium guajava |
Quercus petraea |
Quercus robur |
Quercus suber |
Syzygium aqueum |
Syzygium grande |
PubChem | 492392 |
LOTUS | LTS0028952 |
wikiData | Q5595443 |