Glucodistylin
Internal ID | c12653c3-6eed-4e67-8701-51ea335e7ab7 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-3-O-glycosides |
IUPAC Name | 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3-dihydrochromen-4-one |
SMILES (Canonical) | C1=CC(=C(C=C1C2C(C(=O)C3=C(C=C(C=C3O2)O)O)OC4C(C(C(C(O4)CO)O)O)O)O)O |
SMILES (Isomeric) | C1=CC(=C(C=C1C2C(C(=O)C3=C(C=C(C=C3O2)O)O)OC4C(C(C(C(O4)CO)O)O)O)O)O |
InChI | InChI=1S/C21H22O12/c22-6-13-15(27)17(29)18(30)21(32-13)33-20-16(28)14-11(26)4-8(23)5-12(14)31-19(20)7-1-2-9(24)10(25)3-7/h1-5,13,15,17-27,29-30H,6H2 |
InChI Key | FVQOMEDMFUMIMO-UHFFFAOYSA-N |
Popularity | 2 references in papers |
Molecular Formula | C21H22O12 |
Molecular Weight | 466.40 g/mol |
Exact Mass | 466.11112613 g/mol |
Topological Polar Surface Area (TPSA) | 207.00 Ų |
XlogP | -0.10 |
CHEBI:177943 |
2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3-dihydrochromen-4-one |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.66% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 93.86% | 91.49% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.66% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.00% | 95.56% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 90.78% | 99.15% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.17% | 89.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 89.88% | 94.73% |
CHEMBL2581 | P07339 | Cathepsin D | 89.43% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.73% | 97.09% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 87.52% | 86.92% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.45% | 99.23% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.35% | 86.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.89% | 99.17% |
CHEMBL3194 | P02766 | Transthyretin | 84.14% | 90.71% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.98% | 94.45% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.78% | 94.00% |
CHEMBL4208 | P20618 | Proteasome component C5 | 82.52% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Fagus sylvatica |
Hibiscus mutabilis |
Mangifera indica |
Quercus acutissima |
Quercus mongolica |
Rhododendron luteum |
Taxillus kaempferi |
Trachelospermum jasminoides |
PubChem | 14187088 |
LOTUS | LTS0053474 |
wikiData | Q105002707 |