Gancaonin N
Internal ID | 8767239c-ad61-48c8-917c-27776d2827d6 |
Taxonomy | Phenylpropanoids and polyketides > Isoflavonoids > Isoflavans > Isoflavanones > 6-prenylated isoflavanones |
IUPAC Name | 5,7-dihydroxy-3-(2-hydroxy-4-methoxyphenyl)-6-(3-methylbut-2-enyl)chromen-4-one |
SMILES (Canonical) | CC(=CCC1=C(C2=C(C=C1O)OC=C(C2=O)C3=C(C=C(C=C3)OC)O)O)C |
SMILES (Isomeric) | CC(=CCC1=C(C2=C(C=C1O)OC=C(C2=O)C3=C(C=C(C=C3)OC)O)O)C |
InChI | InChI=1S/C21H20O6/c1-11(2)4-6-14-17(23)9-18-19(20(14)24)21(25)15(10-27-18)13-7-5-12(26-3)8-16(13)22/h4-5,7-10,22-24H,6H2,1-3H3 |
InChI Key | STFVTZQCNYBLNE-UHFFFAOYSA-N |
Popularity | 4 references in papers |
Molecular Formula | C21H20O6 |
Molecular Weight | 368.40 g/mol |
Exact Mass | 368.12598835 g/mol |
Topological Polar Surface Area (TPSA) | 96.20 Ų |
XlogP | 4.60 |
129145-52-4 |
5,7,2'-Trihydroxy-4'-methoxy-6-prenylisoflavone |
5,7-dihydroxy-3-(2-hydroxy-4-methoxyphenyl)-6-(3-methylbut-2-enyl)chromen-4-one |
SCHEMBL1170765 |
CHEBI:175732 |
DTXSID301121050 |
LMPK12050297 |
AKOS040761761 |
2',5,7-Trihydroxy-4'-methoxy-6-prenylisoflavone |
5,7-Dihydroxy-3-(2-hydroxy-4-methoxyphenyl)-6-(3-methyl-2-buten-1-yl)-4H-1-benzopyran-4-one |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.78% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 97.63% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.24% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.89% | 95.56% |
CHEMBL4208 | P20618 | Proteasome component C5 | 92.60% | 90.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.69% | 94.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.27% | 99.17% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 91.27% | 99.15% |
CHEMBL3401 | O75469 | Pregnane X receptor | 88.01% | 94.73% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 87.14% | 91.49% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.14% | 89.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 83.31% | 85.14% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.24% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Glycyrrhiza |
Glycyrrhiza glabra |
Glycyrrhiza inflata |
Glycyrrhiza uralensis |
Glycyrrhiza uralensis |
Mitracarpus hirtus |
PubChem | 14604080 |
NPASS | NPC136268 |
LOTUS | LTS0211874 |
wikiData | Q104389534 |