Ethyl glucoside
| Internal ID | a2f59587-7dd1-4c71-870c-55a61f0af64e |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > O-glycosyl compounds |
| IUPAC Name | 2-ethoxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES (Canonical) | CCOC1C(C(C(C(O1)CO)O)O)O |
| SMILES (Isomeric) | CCOC1C(C(C(C(O1)CO)O)O)O |
| InChI | InChI=1S/C8H16O6/c1-2-13-8-7(12)6(11)5(10)4(3-9)14-8/h4-12H,2-3H2,1H3 |
| InChI Key | WYUFTYLVLQZQNH-UHFFFAOYSA-N |
| Popularity | 30 references in papers |
| Molecular Formula | C8H16O6 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.09468823 g/mol |
| Topological Polar Surface Area (TPSA) | 99.40 Ų |
| XlogP | -1.80 |
| Ethyl Alpha-D-Glucoside |
| 2-ethoxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| 3198-49-0 |
| alpha-Ethyl glucoside |
| Glucopyranoside, ethyl |
| 30285-48-4 |
| Ethyl alpha-D-galactoside;Ethyl alpha-D-galactopyranoside |
| octyl-d-glucoside |
| Ethyl D-glucopyranoside; Sucraph AG 6202 |
| SCHEMBL13102153 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.82% | 96.09% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 85.45% | 96.61% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 83.35% | 94.73% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 83.22% | 97.25% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 82.86% | 91.11% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 82.51% | 95.93% |
| CHEMBL3589 | P55263 | Adenosine kinase | 82.26% | 98.05% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.22% | 97.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.31% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Clerodendrum mandarinorum |
| Euterpe precatoria |
| Glehnia littoralis |
| Iris tenuifolia |
| Justicia adhatoda |
| Rubus niveus |
| Salsola collina |
| Sisyrinchium palmifolium |
| Tylosema esculentum |
| PubChem | 428040 |
| LOTUS | LTS0028146 |
| wikiData | Q104888917 |