[6-[2-(3,4-Dihydroxyphenyl)-2-methoxyethoxy]-5-hydroxy-2-(hydroxymethyl)-4-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-3-yl] 3-(3,4-dihydroxyphenyl)prop-2-enoate
Internal ID | 233f53bb-843e-4bd8-9686-40d18490778c |
Taxonomy | Phenylpropanoids and polyketides > Cinnamic acids and derivatives > Hydroxycinnamic acids and derivatives > Coumaric acids and derivatives |
IUPAC Name | [6-[2-(3,4-dihydroxyphenyl)-2-methoxyethoxy]-5-hydroxy-2-(hydroxymethyl)-4-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-3-yl] 3-(3,4-dihydroxyphenyl)prop-2-enoate |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(C(OC(C2OC(=O)C=CC3=CC(=C(C=C3)O)O)CO)OCC(C4=CC(=C(C=C4)O)O)OC)O)O)O)O |
SMILES (Isomeric) | CC1C(C(C(C(O1)OC2C(C(OC(C2OC(=O)C=CC3=CC(=C(C=C3)O)O)CO)OCC(C4=CC(=C(C=C4)O)O)OC)O)O)O)O |
InChI | InChI=1S/C30H38O16/c1-13-23(37)24(38)25(39)30(43-13)46-28-26(40)29(42-12-21(41-2)15-5-7-17(33)19(35)10-15)44-20(11-31)27(28)45-22(36)8-4-14-3-6-16(32)18(34)9-14/h3-10,13,20-21,23-35,37-40H,11-12H2,1-2H3 |
InChI Key | OWIYIDLFNMCIFO-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C30H38O16 |
Molecular Weight | 654.60 g/mol |
Exact Mass | 654.21598512 g/mol |
Topological Polar Surface Area (TPSA) | 255.00 Ų |
XlogP | -1.10 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.79% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 98.47% | 91.49% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.74% | 96.09% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 96.47% | 96.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 96.11% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.52% | 89.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 92.51% | 94.73% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.02% | 99.17% |
CHEMBL2581 | P07339 | Cathepsin D | 91.89% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.20% | 95.56% |
CHEMBL3194 | P02766 | Transthyretin | 88.12% | 90.71% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.40% | 85.14% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 87.13% | 97.36% |
CHEMBL4208 | P20618 | Proteasome component C5 | 83.13% | 90.00% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 81.86% | 95.93% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.33% | 94.45% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 81.26% | 99.15% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 80.51% | 100.00% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.47% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Campsis grandiflora |
Fraxinus americana |
Plantago depressa |
Sesamum indicum |
Stachys byzantina |
PubChem | 78384638 |
LOTUS | LTS0242946 |
wikiData | Q105202035 |