(E)-Benzyl 3-(4-hydroxyphenyl)acrylate
Internal ID | 9ca1b4be-a6d7-4486-994d-08e9f765d5aa |
Taxonomy | Phenylpropanoids and polyketides > Cinnamic acids and derivatives > Hydroxycinnamic acids and derivatives > Hydroxycinnamic acid esters > Coumaric acid esters |
IUPAC Name | benzyl (E)-3-(4-hydroxyphenyl)prop-2-enoate |
SMILES (Canonical) | C1=CC=C(C=C1)COC(=O)C=CC2=CC=C(C=C2)O |
SMILES (Isomeric) | C1=CC=C(C=C1)COC(=O)/C=C/C2=CC=C(C=C2)O |
InChI | InChI=1S/C16H14O3/c17-15-9-6-13(7-10-15)8-11-16(18)19-12-14-4-2-1-3-5-14/h1-11,17H,12H2/b11-8+ |
InChI Key | RGZZCZQQPNJCPO-DHZHZOJOSA-N |
Popularity | 10 references in papers |
Molecular Formula | C16H14O3 |
Molecular Weight | 254.28 g/mol |
Exact Mass | 254.094294304 g/mol |
Topological Polar Surface Area (TPSA) | 46.50 Ų |
XlogP | 3.30 |
Atomic LogP (AlogP) | 3.15 |
H-Bond Acceptor | 3 |
H-Bond Donor | 1 |
Rotatable Bonds | 4 |
61844-62-0 |
(E)-Benzyl 3-(4-hydroxyphenyl)acrylate |
CHEMBL1095574 |
2-Propenoic acid, 3-(4-hydroxyphenyl)-, phenylmethyl ester, (2E)- |
benzyl-p-coumarate |
Phenylmethyl p-coumarate |
benzyl (E)-p-coumarate |
Benzyl trans-4-coumarate |
SCHEMBL4501585 |
RGZZCZQQPNJCPO-DHZHZOJOSA-N |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9973 | 99.73% |
Caco-2 | + | 0.6345 | 63.45% |
Blood Brain Barrier | - | 0.5000 | 50.00% |
Human oral bioavailability | - | 0.8143 | 81.43% |
Subcellular localzation | Mitochondria | 0.8869 | 88.69% |
OATP2B1 inhibitior | - | 1.0000 | 100.00% |
OATP1B1 inhibitior | + | 0.9098 | 90.98% |
OATP1B3 inhibitior | + | 0.9195 | 91.95% |
MATE1 inhibitior | - | 0.6000 | 60.00% |
OCT2 inhibitior | - | 0.8750 | 87.50% |
BSEP inhibitior | - | 0.4659 | 46.59% |
P-glycoprotein inhibitior | - | 0.9555 | 95.55% |
P-glycoprotein substrate | - | 0.9743 | 97.43% |
CYP3A4 substrate | - | 0.5949 | 59.49% |
CYP2C9 substrate | - | 0.6000 | 60.00% |
CYP2D6 substrate | - | 0.8578 | 85.78% |
CYP3A4 inhibition | - | 0.9200 | 92.00% |
CYP2C9 inhibition | - | 0.8943 | 89.43% |
CYP2C19 inhibition | + | 0.5225 | 52.25% |
CYP2D6 inhibition | - | 0.9392 | 93.92% |
CYP1A2 inhibition | + | 0.6006 | 60.06% |
CYP2C8 inhibition | + | 0.7624 | 76.24% |
CYP inhibitory promiscuity | + | 0.5411 | 54.11% |
UGT catelyzed | - | 0.5000 | 50.00% |
Carcinogenicity (binary) | - | 0.6719 | 67.19% |
Carcinogenicity (trinary) | Non-required | 0.6071 | 60.71% |
Eye corrosion | - | 0.9905 | 99.05% |
Eye irritation | + | 0.9689 | 96.89% |
Skin irritation | - | 0.6461 | 64.61% |
Skin corrosion | - | 0.9927 | 99.27% |
Ames mutagenesis | - | 0.8200 | 82.00% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.4686 | 46.86% |
Micronuclear | - | 0.5493 | 54.93% |
Hepatotoxicity | - | 0.6573 | 65.73% |
skin sensitisation | + | 0.5000 | 50.00% |
Respiratory toxicity | - | 0.9556 | 95.56% |
Reproductive toxicity | - | 0.8222 | 82.22% |
Mitochondrial toxicity | - | 0.8375 | 83.75% |
Nephrotoxicity | - | 0.7039 | 70.39% |
Acute Oral Toxicity (c) | III | 0.7839 | 78.39% |
Estrogen receptor binding | + | 0.8903 | 89.03% |
Androgen receptor binding | + | 0.9289 | 92.89% |
Thyroid receptor binding | - | 0.6210 | 62.10% |
Glucocorticoid receptor binding | - | 0.6990 | 69.90% |
Aromatase binding | + | 0.6972 | 69.72% |
PPAR gamma | + | 0.5668 | 56.68% |
Honey bee toxicity | - | 0.8850 | 88.50% |
Biodegradation | - | 0.5500 | 55.00% |
Crustacea aquatic toxicity | - | 0.5755 | 57.55% |
Fish aquatic toxicity | + | 0.9885 | 98.85% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL5983 | O60218 | Aldo-keto reductase family 1 member B10 |
130 nM 130 nM |
IC50 IC50 |
PMID: 22236472
via Super-PRED |
CHEMBL1900 | P15121 | Aldose reductase |
2200 nM |
IC50 |
PMID: 22236472
|
CHEMBL3729 | P22748 | Carbonic anhydrase IV |
18700 nM |
Ki |
PMID: 26498394
|
CHEMBL3594 | Q16790 | Carbonic anhydrase IX |
860 nM 860 nM |
Ki Ki |
PMID: 26498394
via Super-PRED |
CHEMBL4789 | P35218 | Carbonic anhydrase VA |
970 nM 970 nM |
Ki Ki |
PMID: 26498394
via Super-PRED |
CHEMBL3969 | Q9Y2D0 | Carbonic anhydrase VB |
800 nM 800 nM |
Ki Ki |
PMID: 26498394
via Super-PRED |
CHEMBL3025 | P23280 | Carbonic anhydrase VI |
730 nM 730 nM |
Ki Ki |
PMID: 26498394
via Super-PRED |
CHEMBL2326 | P43166 | Carbonic anhydrase VII |
720 nM 720 nM |
Ki Ki |
PMID: 26498394
via Super-PRED |
CHEMBL3242 | O43570 | Carbonic anhydrase XII |
29400 nM |
Ki |
PMID: 26498394
|
CHEMBL3510 | Q9ULX7 | Carbonic anhydrase XIV |
810 nM 810 nM |
Ki Ki |
via Super-PRED
PMID: 26498394 |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.29% | 86.33% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 93.34% | 91.71% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.95% | 95.56% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.71% | 99.17% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.44% | 91.11% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 90.53% | 94.62% |
CHEMBL2581 | P07339 | Cathepsin D | 90.02% | 98.95% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 88.31% | 95.50% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.23% | 96.09% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 84.96% | 89.67% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.55% | 96.00% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 83.29% | 90.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 10083644 |
NPASS | NPC206341 |
ChEMBL | CHEMBL1095574 |
LOTUS | LTS0016937 |
wikiData | Q105236207 |