DL-Histidine
| Internal ID | 5a5de971-2668-4991-95ae-6c527a303464 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Alpha amino acids and derivatives > Histidine and derivatives |
| IUPAC Name | 2-amino-3-(1H-imidazol-5-yl)propanoic acid |
| SMILES (Canonical) | C1=C(NC=N1)CC(C(=O)O)N |
| SMILES (Isomeric) | C1=C(NC=N1)CC(C(=O)O)N |
| InChI | InChI=1S/C6H9N3O2/c7-5(6(10)11)1-4-2-8-3-9-4/h2-3,5H,1,7H2,(H,8,9)(H,10,11) |
| InChI Key | HNDVDQJCIGZPNO-UHFFFAOYSA-N |
| Popularity | 941 references in papers |
| Molecular Formula | C6H9N3O2 |
| Molecular Weight | 155.15 g/mol |
| Exact Mass | 155.069476538 g/mol |
| Topological Polar Surface Area (TPSA) | 92.00 Ų |
| XlogP | -3.20 |
| 4998-57-6 |
| 2-amino-3-(1H-imidazol-4-yl)propanoic acid |
| H-DL-His-OH |
| D,L-histidine |
| Histidine, DL- |
| 2-amino-3-(1H-imidazol-5-yl)propanoic acid |
| MFCD00005208 |
| QU6SDF3Q03 |
| DL-2-Amino-3-(4-imidazolyl)propionsaeure |
| 26062-48-6 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.43% | 96.09% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 93.42% | 83.82% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 92.64% | 92.29% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 91.66% | 90.20% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 88.39% | 90.17% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.82% | 94.45% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.20% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Abutilon indicum |
| Arabidopsis thaliana |
| Castanea sativa |
| Catha edulis |
| Lupinus albus |
| Pseudostellaria heterophylla |
| Solanum lycopersicum |
| Stellaria media |
| PubChem | 773 |
| LOTUS | LTS0198131 |
| wikiData | Q27103201 |