DL-Asparagine
| Internal ID | 7cb027ae-b12c-4f35-8623-b7f4fc2a4cba |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Alpha amino acids and derivatives > Asparagine and derivatives |
| IUPAC Name | 2,4-diamino-4-oxobutanoic acid |
| SMILES (Canonical) | C(C(C(=O)O)N)C(=O)N |
| SMILES (Isomeric) | C(C(C(=O)O)N)C(=O)N |
| InChI | InChI=1S/C4H8N2O3/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H2,6,7)(H,8,9) |
| InChI Key | DCXYFEDJOCDNAF-UHFFFAOYSA-N |
| Popularity | 5,627 references in papers |
| Molecular Formula | C4H8N2O3 |
| Molecular Weight | 132.12 g/mol |
| Exact Mass | 132.05349212 g/mol |
| Topological Polar Surface Area (TPSA) | 106.00 Ų |
| XlogP | -3.40 |
| 3130-87-8 |
| 2,4-diamino-4-oxobutanoic acid |
| Asparagine, DL- |
| 2-amino-3-carbamoylpropanoic acid |
| 7006-34-0 |
| 2-amino-3-carbamoyl-propanoic acid |
| asparagin |
| NSC7891 |
| NSC82391 |
| H-Asn-OH HO |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.43% | 96.09% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 92.69% | 83.82% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 87.61% | 96.95% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 84.62% | 90.20% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 83.57% | 92.29% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 82.73% | 90.17% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 82.33% | 97.21% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.66% | 99.17% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 80.80% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| PubChem | 236 |
| LOTUS | LTS0098376 |
| wikiData | Q185906 |