Digitoxin
Internal ID | 68d94ae3-1300-4ec6-a049-d10d32eb05fa |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroid lactones > Cardenolides and derivatives > Cardenolide glycosides and derivatives |
IUPAC Name | 3-[(3S,5R,8R,9S,10S,13R,14S,17R)-3-[(2R,4S,5S,6R)-5-[(2S,4S,5S,6R)-5-[(2S,4S,5S,6R)-4,5-dihydroxy-6-methyloxan-2-yl]oxy-4-hydroxy-6-methyloxan-2-yl]oxy-4-hydroxy-6-methyloxan-2-yl]oxy-14-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-2H-furan-5-one |
SMILES (Canonical) | CC1C(C(CC(O1)OC2C(OC(CC2O)OC3C(OC(CC3O)OC4CCC5(C(C4)CCC6C5CCC7(C6(CCC7C8=CC(=O)OC8)O)C)C)C)C)O)O |
SMILES (Isomeric) | C[C@@H]1[C@H]([C@H](C[C@@H](O1)O[C@@H]2[C@H](O[C@H](C[C@@H]2O)O[C@@H]3[C@H](O[C@H](C[C@@H]3O)O[C@H]4CC[C@]5([C@@H](C4)CC[C@@H]6[C@@H]5CC[C@]7([C@@]6(CC[C@@H]7C8=CC(=O)OC8)O)C)C)C)C)O)O |
InChI | InChI=1S/C41H64O13/c1-20-36(46)29(42)16-34(49-20)53-38-22(3)51-35(18-31(38)44)54-37-21(2)50-33(17-30(37)43)52-25-8-11-39(4)24(15-25)6-7-28-27(39)9-12-40(5)26(10-13-41(28,40)47)23-14-32(45)48-19-23/h14,20-22,24-31,33-38,42-44,46-47H,6-13,15-19H2,1-5H3/t20-,21-,22-,24-,25+,26-,27+,28-,29+,30+,31+,33+,34+,35+,36-,37-,38-,39+,40-,41+/m1/s1 |
InChI Key | WDJUZGPOPHTGOT-XUDUSOBPSA-N |
Popularity | 7,377 references in papers |
Molecular Formula | C41H64O13 |
Molecular Weight | 764.90 g/mol |
Exact Mass | 764.43469209 g/mol |
Topological Polar Surface Area (TPSA) | 183.00 Ų |
XlogP | 2.30 |
Atomic LogP (AlogP) | 3.25 |
H-Bond Acceptor | 13 |
H-Bond Donor | 5 |
Rotatable Bonds | 7 |
71-63-6 |
Digitoxoside |
Crystodigin |
Digitoxinum |
Unidigin |
Digitophyllin |
Cristapurat |
Digitoksin |
Purpurid |
Cardidigin |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9631 | 96.31% |
Caco-2 | - | 0.9257 | 92.57% |
Blood Brain Barrier | - | 0.9250 | 92.50% |
Human oral bioavailability | + | 0.8286 | 82.86% |
Subcellular localzation | Mitochondria | 0.8620 | 86.20% |
OATP2B1 inhibitior | - | 0.9048 | 90.48% |
OATP1B1 inhibitior | + | 0.9441 | 94.41% |
OATP1B3 inhibitior | + | 0.9479 | 94.79% |
MATE1 inhibitior | - | 1.0000 | 100.00% |
OCT2 inhibitior | - | 0.9750 | 97.50% |
BSEP inhibitior | + | 0.8864 | 88.64% |
P-glycoprotein inhibitior | + | 0.7320 | 73.20% |
P-glycoprotein substrate | + | 0.9343 | 93.43% |
CYP3A4 substrate | + | 0.6580 | 65.80% |
CYP2C9 substrate | - | 1.0000 | 100.00% |
CYP2D6 substrate | - | 0.9026 | 90.26% |
CYP3A4 inhibition | - | 0.9010 | 90.10% |
CYP2C9 inhibition | - | 0.9082 | 90.82% |
CYP2C19 inhibition | - | 0.9258 | 92.58% |
CYP2D6 inhibition | - | 0.9412 | 94.12% |
CYP1A2 inhibition | - | 0.8902 | 89.02% |
CYP2C8 inhibition | - | 0.9392 | 93.92% |
CYP inhibitory promiscuity | - | 0.9381 | 93.81% |
UGT catelyzed | + | 0.7000 | 70.00% |
Carcinogenicity (binary) | - | 1.0000 | 100.00% |
Carcinogenicity (trinary) | Non-required | 0.5211 | 52.11% |
Eye corrosion | - | 0.9909 | 99.09% |
Eye irritation | - | 0.9541 | 95.41% |
Skin irritation | + | 0.5730 | 57.30% |
Skin corrosion | - | 0.9385 | 93.85% |
Ames mutagenesis | - | 0.5324 | 53.24% |
Human Ether-a-go-go-Related Gene inhibition | + | 0.8599 | 85.99% |
Micronuclear | - | 0.8300 | 83.00% |
Hepatotoxicity | - | 0.8750 | 87.50% |
skin sensitisation | - | 0.9061 | 90.61% |
Respiratory toxicity | + | 0.9000 | 90.00% |
Reproductive toxicity | + | 0.9000 | 90.00% |
Mitochondrial toxicity | + | 0.7000 | 70.00% |
Nephrotoxicity | - | 0.8531 | 85.31% |
Acute Oral Toxicity (c) | I | 0.7997 | 79.97% |
Estrogen receptor binding | + | 0.8906 | 89.06% |
Androgen receptor binding | + | 0.8695 | 86.95% |
Thyroid receptor binding | - | 0.8319 | 83.19% |
Glucocorticoid receptor binding | + | 0.6759 | 67.59% |
Aromatase binding | + | 0.8063 | 80.63% |
PPAR gamma | + | 0.7433 | 74.33% |
Honey bee toxicity | - | 0.6831 | 68.31% |
Biodegradation | - | 0.6750 | 67.50% |
Crustacea aquatic toxicity | + | 0.6300 | 63.00% |
Fish aquatic toxicity | + | 0.9797 | 97.97% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL4096 | P04637 | Cellular tumor antigen p53 |
20 nM 31.6 nM 31.6 nM |
Potency Potency Potency |
via Super-PRED
via CMAUP via Super-PRED |
CHEMBL1293224 | P10636 | Microtubule-associated protein tau |
7079.5 nM 14125.4 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL1293277 | O15118 | Niemann-Pick C1 protein |
251.2 nM 251.2 nM |
Potency Potency |
via Super-PRED
via CMAUP |
CHEMBL1293235 | P02545 | Prelamin-A/C |
1122 nM 707.9 nM 707.9 nM |
Potency Potency Potency |
via CMAUP
via Super-PRED via CMAUP |
CHEMBL1293294 | P51151 | Ras-related protein Rab-9A |
223.9 nM 223.9 nM |
Potency Potency |
via Super-PRED
via CMAUP |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 |
700 nM 700 nM |
IC50 IC50 |
via Super-PRED
via CMAUP |
CHEMBL2073690 | Q6ZQN7 | Solute carrier organic anion transporter family member 4C1 |
120 nM |
IC50 |
PMID: 14993604
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.88% | 91.11% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 96.32% | 100.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.11% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.85% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.49% | 97.09% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 92.08% | 96.77% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.33% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.34% | 95.56% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 87.67% | 92.94% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 86.70% | 85.14% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.24% | 95.89% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.92% | 94.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.32% | 99.23% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.99% | 89.00% |
CHEMBL1871 | P10275 | Androgen Receptor | 83.95% | 96.43% |
CHEMBL2581 | P07339 | Cathepsin D | 81.75% | 98.95% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.60% | 97.14% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 80.91% | 97.25% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.74% | 90.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.38% | 90.71% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 80.15% | 97.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 441207 |
NPASS | NPC72260 |
ChEMBL | CHEMBL254219 |
LOTUS | LTS0093833 |
wikiData | Q423890 |