Crotonic acid
| Internal ID | ba60dbf2-89c6-4e8d-bd2b-2dd65461f184 |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty acids and conjugates > Straight chain fatty acids |
| IUPAC Name | (E)-but-2-enoic acid |
| SMILES (Canonical) | CC=CC(=O)O |
| SMILES (Isomeric) | C/C=C/C(=O)O |
| InChI | InChI=1S/C4H6O2/c1-2-3-4(5)6/h2-3H,1H3,(H,5,6)/b3-2+ |
| InChI Key | LDHQCZJRKDOVOX-NSCUHMNNSA-N |
| Popularity | 1,196 references in papers |
| Molecular Formula | C4H6O2 |
| Molecular Weight | 86.09 g/mol |
| Exact Mass | 86.036779430 g/mol |
| Topological Polar Surface Area (TPSA) | 37.30 Ų |
| XlogP | 0.70 |
| 107-93-7 |
| (E)-but-2-enoic acid |
| 3724-65-0 |
| trans-2-Butenoic acid |
| 2-Butenoic acid |
| trans-Crotonic acid |
| (E)-2-Butenoic acid |
| but-2-enoic acid |
| BUTENOIC ACID |
| (E)-Crotonic acid |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 90.48% | 83.82% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Brucea javanica |
| Chaenomeles sinensis |
| Coffea arabica |
| Croton tiglium |
| Daucus carota |
| PubChem | 637090 |
| NPASS | NPC297363 |
| ChEMBL | CHEMBL1213528 |
| LOTUS | LTS0124089 |
| wikiData | Q414207 |