Crocetin
| Internal ID | a483cc13-1d72-42a2-b497-9c66b71e8683 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Acyclic diterpenoids |
| IUPAC Name | (2E,4E,6E,8E,10E,12E,14E)-2,6,11,15-tetramethylhexadeca-2,4,6,8,10,12,14-heptaenedioic acid |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C20H24O4/c1-15(11-7-13-17(3)19(21)22)9-5-6-10-16(2)12-8-14-18(4)20(23)24/h5-14H,1-4H3,(H,21,22)(H,23,24)/b6-5+,11-7+,12-8+,15-9+,16-10+,17-13+,18-14+ |
| InChI Key | PANKHBYNKQNAHN-MQQNZMFNSA-N |
| Popularity | 970 references in papers |
| Molecular Formula | C20H24O4 |
| Molecular Weight | 328.40 g/mol |
| Exact Mass | 328.16745924 g/mol |
| Topological Polar Surface Area (TPSA) | 74.60 Ų |
| XlogP | 5.40 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL221 | P23219 | Cyclooxygenase-1 |
28000 nM |
IC50 |
PMID: 16038536
|
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2061 | P19793 | Retinoid X receptor alpha | 81.05% | 91.67% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.77% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Brassica oleracea |
| Crocus sativus |
| Crocus vernus |
| Gardenia jasminoides |
| Verbascum lychnitis |
| PubChem | 5281232 |
| NPASS | NPC43053 |
| ChEMBL | CHEMBL464792 |
| LOTUS | LTS0129423 |
| wikiData | Q2714546 |