Clausine K
Internal ID | db57634b-13d9-4329-948b-7cbe7a933845 |
Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Carbazoles |
IUPAC Name | 2,7-dimethoxy-9H-carbazole-3-carboxylic acid |
SMILES (Canonical) | COC1=CC2=C(C=C1)C3=CC(=C(C=C3N2)OC)C(=O)O |
SMILES (Isomeric) | COC1=CC2=C(C=C1)C3=CC(=C(C=C3N2)OC)C(=O)O |
InChI | InChI=1S/C15H13NO4/c1-19-8-3-4-9-10-6-11(15(17)18)14(20-2)7-13(10)16-12(9)5-8/h3-7,16H,1-2H3,(H,17,18) |
InChI Key | LDKCHJXUOLZQQV-UHFFFAOYSA-N |
Popularity | 6 references in papers |
Molecular Formula | C15H13NO4 |
Molecular Weight | 271.27 g/mol |
Exact Mass | 271.08445790 g/mol |
Topological Polar Surface Area (TPSA) | 71.60 Ų |
XlogP | 2.90 |
2,7-Dimethoxy-9H-carbazole-3-carboxylic acid |
CHEBI:69938 |
182261-96-7 |
CHEMBL1689806 |
SCHEMBL17817139 |
DTXSID801318460 |
Q27138281 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.17% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.51% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.40% | 95.56% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.93% | 91.11% |
CHEMBL2535 | P11166 | Glucose transporter | 92.66% | 98.75% |
CHEMBL4208 | P20618 | Proteasome component C5 | 89.92% | 90.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.76% | 99.17% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.76% | 94.00% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 85.41% | 97.36% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.40% | 86.33% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 84.12% | 93.00% |
CHEMBL1907 | P15144 | Aminopeptidase N | 82.53% | 93.31% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 82.46% | 95.50% |
CHEMBL2581 | P07339 | Cathepsin D | 81.13% | 98.95% |
CHEMBL2292 | Q13627 | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | 81.10% | 93.24% |
CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 81.04% | 95.56% |
CHEMBL1811 | P34995 | Prostanoid EP1 receptor | 80.37% | 95.71% |
CHEMBL1868 | P17948 | Vascular endothelial growth factor receptor 1 | 80.32% | 96.47% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 504070 |
NPASS | NPC174760 |
ChEMBL | CHEMBL1689806 |
LOTUS | LTS0172703 |
wikiData | Q27138281 |