Clauraila D
Internal ID | a14d79fb-af63-4873-a870-b4c32a8d947e |
Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Carbazoles |
IUPAC Name | 9-hydroxy-3,3-dimethyl-7H-pyrano[2,3-c]carbazole-10-carbaldehyde |
SMILES (Canonical) | CC1(C=CC2=C(O1)C=CC3=C2C4=C(N3)C=C(C(=C4)C=O)O)C |
SMILES (Isomeric) | CC1(C=CC2=C(O1)C=CC3=C2C4=C(N3)C=C(C(=C4)C=O)O)C |
InChI | InChI=1S/C18H15NO3/c1-18(2)6-5-11-16(22-18)4-3-13-17(11)12-7-10(9-20)15(21)8-14(12)19-13/h3-9,19,21H,1-2H3 |
InChI Key | FKVAMCZERBVNQE-UHFFFAOYSA-N |
Popularity | 2 references in papers |
Molecular Formula | C18H15NO3 |
Molecular Weight | 293.30 g/mol |
Exact Mass | 293.10519334 g/mol |
Topological Polar Surface Area (TPSA) | 62.30 Ų |
XlogP | 4.00 |
CHEBI:69925 |
Claurailas D |
Clauralia D |
CHEMBL1689798 |
Q27138269 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 99.74% | 94.45% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.01% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 97.11% | 91.49% |
CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 96.38% | 98.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.54% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 93.18% | 98.95% |
CHEMBL4208 | P20618 | Proteasome component C5 | 92.47% | 90.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.82% | 89.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.65% | 96.09% |
CHEMBL2292 | Q13627 | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | 89.04% | 93.24% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 88.00% | 94.80% |
CHEMBL2535 | P11166 | Glucose transporter | 87.11% | 98.75% |
CHEMBL4225 | P49760 | Dual specificity protein kinase CLK2 | 84.97% | 80.96% |
CHEMBL3401 | O75469 | Pregnane X receptor | 84.40% | 94.73% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 83.34% | 94.75% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.82% | 86.33% |
CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 82.55% | 85.30% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 82.54% | 91.71% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 81.62% | 93.40% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 51039828 |
NPASS | NPC6786 |
ChEMBL | CHEMBL1689798 |
LOTUS | LTS0259290 |
wikiData | Q27138269 |