Cistocardin
Internal ID | 8c44922a-11b4-4498-a954-ac2ba5a6ed45 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
IUPAC Name | 2-[2-[4,5-dihydroxy-2-(hydroxymethyl)-6-(15-hydroxy-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-16-yl)oxyoxan-3-yl]oxy-5-hydroxy-6-(hydroxymethyl)-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-4-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
SMILES (Canonical) | CC1CCC2(C(C3C(O2)CC4C3(CCC5C4CCC6C5(CC(C(C6)OC7C(C(C(C(O7)CO)OC8C(C(C(C(O8)CO)O)OC9C(C(C(C(O9)CO)O)O)O)OC2C(C(C(C(O2)CO)O)O)O)O)O)O)C)C)C)OC1 |
SMILES (Isomeric) | CC1CCC2(C(C3C(O2)CC4C3(CCC5C4CCC6C5(CC(C(C6)OC7C(C(C(C(O7)CO)OC8C(C(C(C(O8)CO)O)OC9C(C(C(C(O9)CO)O)O)O)OC2C(C(C(C(O2)CO)O)O)O)O)O)O)C)C)C)OC1 |
InChI | InChI=1S/C51H84O24/c1-19-7-10-51(66-18-19)20(2)32-27(75-51)12-24-22-6-5-21-11-26(25(56)13-50(21,4)23(22)8-9-49(24,32)3)67-45-41(65)38(62)42(31(17-55)71-45)72-48-44(74-47-40(64)37(61)34(58)29(15-53)69-47)43(35(59)30(16-54)70-48)73-46-39(63)36(60)33(57)28(14-52)68-46/h19-48,52-65H,5-18H2,1-4H3 |
InChI Key | OJXYLGQQFXELNY-UHFFFAOYSA-N |
Popularity | 4 references in papers |
Molecular Formula | C51H84O24 |
Molecular Weight | 1081.20 g/mol |
Exact Mass | 1080.53525354 g/mol |
Topological Polar Surface Area (TPSA) | 376.00 Ų |
XlogP | -1.40 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.43% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.69% | 91.11% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 96.01% | 96.61% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.93% | 97.09% |
CHEMBL237 | P41145 | Kappa opioid receptor | 94.01% | 98.10% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 92.70% | 100.00% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 92.45% | 95.50% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 91.69% | 96.21% |
CHEMBL233 | P35372 | Mu opioid receptor | 91.16% | 97.93% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 90.85% | 92.86% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 89.30% | 95.93% |
CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 89.30% | 97.86% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 89.27% | 92.50% |
CHEMBL259 | P32245 | Melanocortin receptor 4 | 88.34% | 95.38% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 87.94% | 95.58% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 86.28% | 89.05% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.03% | 95.89% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.80% | 94.45% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 85.35% | 100.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 85.29% | 95.89% |
CHEMBL204 | P00734 | Thrombin | 84.79% | 96.01% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 84.57% | 96.38% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 84.14% | 96.77% |
CHEMBL5524 | Q99873 | Protein-arginine N-methyltransferase 1 | 83.31% | 96.67% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 82.69% | 97.25% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 82.38% | 97.28% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 82.22% | 97.29% |
CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 81.90% | 97.31% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 81.84% | 86.92% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 80.95% | 95.83% |
CHEMBL4370 | P16662 | UDP-glucuronosyltransferase 2B7 | 80.91% | 100.00% |
CHEMBL2095194 | P08709 | Coagulation factor VII/tissue factor | 80.26% | 99.17% |
CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 80.26% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Agave utahensis |
Allium chinense |
Chlorophytum borivilianum |
Hosta longipes |
PubChem | 73157303 |
LOTUS | LTS0138561 |
wikiData | Q105193386 |