CID 163190001
Internal ID | d227cb97-4cfe-40c4-86c0-a872057f7156 |
Taxonomy | Alkaloids and derivatives > Eburnan-type alkaloids |
IUPAC Name | (15R,17R,19R)-15-ethyl-1,11-diazapentacyclo[9.6.2.02,7.08,18.015,19]nonadeca-2,4,6,8(18)-tetraen-17-ol |
SMILES (Canonical) | CCC12CCCN3C1C4=C(CC3)C5=CC=CC=C5N4C(C2)O.CCC12CCCN3C1C4=C(CC3)C5=CC=CC=C5N4C(C2)O |
SMILES (Isomeric) | CC[C@]12CCCN3[C@H]1C4=C(CC3)C5=CC=CC=C5N4[C@@H](C2)O.CC[C@]12CCCN3[C@H]1C4=C(CC3)C5=CC=CC=C5N4[C@@H](C2)O |
InChI | InChI=1S/2C19H24N2O/c2*1-2-19-9-5-10-20-11-8-14-13-6-3-4-7-15(13)21(16(22)12-19)17(14)18(19)20/h2*3-4,6-7,16,18,22H,2,5,8-12H2,1H3/t2*16-,18+,19-/m11/s1 |
InChI Key | MVHKLDGIDGYCRU-UZOVSVAJSA-N |
Popularity | 0 references in papers |
Molecular Formula | C38H48N4O2 |
Molecular Weight | 592.80 g/mol |
Exact Mass | 592.37772679 g/mol |
Topological Polar Surface Area (TPSA) | 56.80 Ų |
XlogP | 0.00 |
There are no found synonyms. |
![2D Structure of CID 163190001 2D Structure of CID 163190001](https://plantaedb.com/storage/docs/compounds/2023/11/cid-163190001.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.41% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.66% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.68% | 95.56% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.77% | 91.11% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 93.26% | 93.99% |
CHEMBL240 | Q12809 | HERG | 87.82% | 89.76% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.18% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 87.09% | 98.95% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 85.23% | 95.83% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 85.19% | 90.17% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.53% | 97.09% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 84.05% | 92.62% |
CHEMBL4208 | P20618 | Proteasome component C5 | 83.08% | 90.00% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 82.28% | 89.63% |
CHEMBL255 | P29275 | Adenosine A2b receptor | 81.65% | 98.59% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.77% | 89.00% |
CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 80.65% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Hunteria zeylanica |
Kopsia griffithii |
Kopsia larutensis |
Kopsia pauciflora |
Kopsia profunda |
Leuconotis griffithii |
PubChem | 163190001 |
LOTUS | LTS0239127 |
wikiData | Q104251976 |