CID 162977223
Internal ID | 2144e713-1cc6-4f05-a7fb-1b2ff843700c |
Taxonomy | Organoheterocyclic compounds > Lactones > Gamma butyrolactones |
IUPAC Name | |
SMILES (Canonical) | CC1CC2(C(CC(C3(C2=C)CO3)OC(=O)C)C(=O)C14CC(OC4=O)C5=COC=C5)O |
SMILES (Isomeric) | CC1CC2(C(CC(C3(C2=C)CO3)OC(=O)C)C(=O)C14CC(OC4=O)C5=COC=C5)O |
InChI | InChI=1S/C22H24O8/c1-11-7-21(26)12(2)22(10-28-22)17(29-13(3)23)6-15(21)18(24)20(11)8-16(30-19(20)25)14-4-5-27-9-14/h4-5,9,11,15-17,26H,2,6-8,10H2,1,3H3 |
InChI Key | RDGPPDMUUVUTHY-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C22H24O8 |
Molecular Weight | 416.40 g/mol |
Exact Mass | 416.14711772 g/mol |
Topological Polar Surface Area (TPSA) | 116.00 Ų |
XlogP | 0.30 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.93% | 85.14% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.50% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.94% | 97.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.24% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.80% | 94.45% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.01% | 89.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.58% | 99.23% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.69% | 86.33% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.50% | 94.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.15% | 95.56% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.55% | 91.19% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 82.66% | 90.17% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 82.11% | 93.00% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.24% | 95.50% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.10% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 162977223 |
LOTUS | LTS0227522 |
wikiData | Q104252268 |