Chandrananimycin D
Internal ID | 0d8c2834-fa4c-4e03-9567-27742383f66b |
Taxonomy | Organoheterocyclic compounds > Benzoxazines > Phenoxazines |
IUPAC Name | 2-hydroxy-N-[8-(hydroxymethyl)-3-oxophenoxazin-2-yl]acetamide |
SMILES (Canonical) | C1=CC2=C(C=C1CO)N=C3C=C(C(=O)C=C3O2)NC(=O)CO |
SMILES (Isomeric) | C1=CC2=C(C=C1CO)N=C3C=C(C(=O)C=C3O2)NC(=O)CO |
InChI | InChI=1S/C15H12N2O5/c18-6-8-1-2-13-10(3-8)16-11-4-9(17-15(21)7-19)12(20)5-14(11)22-13/h1-5,18-19H,6-7H2,(H,17,21) |
InChI Key | OQMHQWLKGNKBET-UHFFFAOYSA-N |
Popularity | 2 references in papers |
Molecular Formula | C15H12N2O5 |
Molecular Weight | 300.27 g/mol |
Exact Mass | 300.07462149 g/mol |
Topological Polar Surface Area (TPSA) | 108.00 Ų |
XlogP | -0.70 |
Chandrananomycin D |
CHEMBL1224595 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 97.49% | 81.11% |
CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 96.34% | 87.67% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.58% | 94.00% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.56% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 90.88% | 98.95% |
CHEMBL3401 | O75469 | Pregnane X receptor | 90.42% | 94.73% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 89.97% | 89.34% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.19% | 99.17% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 87.57% | 90.71% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.59% | 86.33% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 83.11% | 94.42% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.00% | 89.00% |
CHEMBL2535 | P11166 | Glucose transporter | 80.35% | 98.75% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.15% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 46939591 |
NPASS | NPC57105 |
ChEMBL | CHEMBL1224595 |
LOTUS | LTS0189442 |
wikiData | Q77513940 |