(3S,5S,8S,9S,10S,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol
Internal ID | d7574b01-93d4-499d-bca4-d47a2a48e809 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Cholestane steroids > Cholesterols and derivatives |
IUPAC Name | (3S,5S,8S,9S,10S,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
SMILES (Canonical) | CC(C)CCCC(C)C1CCC2C1(CCC3C2CCC4C3(CCC(C4)O)C)C |
SMILES (Isomeric) | C[C@H](CCCC(C)C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@@H]2CC[C@@H]4[C@@]3(CC[C@@H](C4)O)C)C |
InChI | InChI=1S/C27H48O/c1-18(2)7-6-8-19(3)23-11-12-24-22-10-9-20-17-21(28)13-15-26(20,4)25(22)14-16-27(23,24)5/h18-25,28H,6-17H2,1-5H3/t19-,20+,21+,22-,23-,24+,25+,26+,27-/m1/s1 |
InChI Key | QYIXCDOBOSTCEI-PNIPQYGLSA-N |
Popularity | 882 references in papers |
Molecular Formula | C27H48O |
Molecular Weight | 388.70 g/mol |
Exact Mass | 388.370516150 g/mol |
Topological Polar Surface Area (TPSA) | 20.20 Ų |
XlogP | 9.40 |
(3S,5S,8S,9S,10S,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.62% | 96.09% |
CHEMBL237 | P41145 | Kappa opioid receptor | 95.11% | 98.10% |
CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 94.83% | 85.31% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.13% | 97.25% |
CHEMBL238 | Q01959 | Dopamine transporter | 92.68% | 95.88% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 91.65% | 90.17% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 90.79% | 95.93% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 90.48% | 82.69% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 90.42% | 95.89% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.98% | 97.09% |
CHEMBL1871 | P10275 | Androgen Receptor | 89.85% | 96.43% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.72% | 94.45% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 89.10% | 90.71% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 88.96% | 91.11% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.49% | 100.00% |
CHEMBL2094135 | Q96BI3 | Gamma-secretase | 87.97% | 98.05% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 85.67% | 95.58% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 85.66% | 100.00% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 85.37% | 93.18% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 84.76% | 92.86% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 84.50% | 97.79% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 84.31% | 96.38% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 84.13% | 89.05% |
CHEMBL268 | P43235 | Cathepsin K | 84.00% | 96.85% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 83.25% | 93.56% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 83.03% | 97.29% |
CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 82.94% | 96.03% |
CHEMBL236 | P41143 | Delta opioid receptor | 82.81% | 99.35% |
CHEMBL233 | P35372 | Mu opioid receptor | 81.52% | 97.93% |
CHEMBL2514 | O95665 | Neurotensin receptor 2 | 81.51% | 100.00% |
CHEMBL299 | P17252 | Protein kinase C alpha | 81.45% | 98.03% |
CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 81.24% | 97.50% |
CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 81.22% | 97.86% |
CHEMBL3921 | Q9Y251 | Heparanase | 81.21% | 94.00% |
CHEMBL2581 | P07339 | Cathepsin D | 80.77% | 98.95% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 80.27% | 92.88% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Avena sativa |
Dioscorea polystachya |
Diplopterygium glaucum |
Kalanchoe petitiana |
Nicotiana tabacum |
Rubus crataegifolius |
Volkameria inermis |
PubChem | 7157118 |
LOTUS | LTS0113615 |
wikiData | Q104253334 |