Brusatol
Internal ID | 07f93e31-e602-43d8-84de-d4d3616b9fbd |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones > Quassinoids |
IUPAC Name | methyl (1R,2S,3R,6R,8R,13S,14R,15R,16S,17S)-10,15,16-trihydroxy-9,13-dimethyl-3-(3-methylbut-2-enoyloxy)-4,11-dioxo-5,18-dioxapentacyclo[12.5.0.01,6.02,17.08,13]nonadec-9-ene-17-carboxylate |
SMILES (Canonical) | CC1=C(C(=O)CC2(C1CC3C45C2C(C(C(C4C(C(=O)O3)OC(=O)C=C(C)C)(OC5)C(=O)OC)O)O)C)O |
SMILES (Isomeric) | CC1=C(C(=O)C[C@]2([C@H]1C[C@@H]3[C@]45[C@@H]2[C@H]([C@@H]([C@]([C@@H]4[C@H](C(=O)O3)OC(=O)C=C(C)C)(OC5)C(=O)OC)O)O)C)O |
InChI | InChI=1S/C26H32O11/c1-10(2)6-15(28)37-18-20-25-9-35-26(20,23(33)34-5)21(31)17(30)19(25)24(4)8-13(27)16(29)11(3)12(24)7-14(25)36-22(18)32/h6,12,14,17-21,29-31H,7-9H2,1-5H3/t12-,14+,17+,18+,19+,20+,21-,24-,25+,26-/m0/s1 |
InChI Key | ZZZYHIMVKOHVIH-VILODJCFSA-N |
Popularity | 97 references in papers |
Molecular Formula | C26H32O11 |
Molecular Weight | 520.50 g/mol |
Exact Mass | 520.19446183 g/mol |
Topological Polar Surface Area (TPSA) | 166.00 Ų |
XlogP | 0.90 |
Atomic LogP (AlogP) | 0.52 |
H-Bond Acceptor | 11 |
H-Bond Donor | 3 |
Rotatable Bonds | 3 |
Yatansin |
14907-98-3 |
(+)-Brusatol |
NSC 172924 |
CHEBI:3197 |
BRN 1444847 |
CHEMBL459546 |
Methyl 13,20-epoxy-3,11,12-trihydroxy-15-((3-methyl-1-oxo-2-butenyl)oxy)-2,16-dioxopicras-3-en-21-oate (11beta,12alpha,15beta)- |
(11beta,12alpha,15beta)-13,20-Epoxy-3,11,12-trihydroxy-15-((3-methyl-1-oxo-2-butenyl)oxy)-2,16-dioxopicras-3-en-21-oic acid, methyl ester |
(1R,2S,3S,3aS,3a1R,4R,6aR,7aR,11aS,11bR)-Methyl 1,2,9-trihydroxy-8,11a-dimethyl-4-((3-methylbut-2-enoyl)oxy)-5,10-dioxo-2,3,3a,4,5,6a,7,7a,10,11,11a,11b-dodecahydro-1H-3,3a1-(epoxymethano)dibenzo[de,g]chromene-3-carboxylate |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9461 | 94.61% |
Caco-2 | - | 0.7850 | 78.50% |
Blood Brain Barrier | - | 0.6750 | 67.50% |
Human oral bioavailability | - | 0.6286 | 62.86% |
Subcellular localzation | Mitochondria | 0.8150 | 81.50% |
OATP2B1 inhibitior | - | 0.8588 | 85.88% |
OATP1B1 inhibitior | + | 0.8646 | 86.46% |
OATP1B3 inhibitior | + | 0.9194 | 91.94% |
MATE1 inhibitior | - | 0.9000 | 90.00% |
OCT2 inhibitior | - | 0.8500 | 85.00% |
BSEP inhibitior | + | 0.9434 | 94.34% |
P-glycoprotein inhibitior | + | 0.6796 | 67.96% |
P-glycoprotein substrate | + | 0.9097 | 90.97% |
CYP3A4 substrate | + | 0.7058 | 70.58% |
CYP2C9 substrate | - | 0.8217 | 82.17% |
CYP2D6 substrate | - | 0.8917 | 89.17% |
CYP3A4 inhibition | - | 0.7852 | 78.52% |
CYP2C9 inhibition | - | 0.7951 | 79.51% |
CYP2C19 inhibition | - | 0.8467 | 84.67% |
CYP2D6 inhibition | - | 0.9413 | 94.13% |
CYP1A2 inhibition | - | 0.8327 | 83.27% |
CYP2C8 inhibition | + | 0.4751 | 47.51% |
CYP inhibitory promiscuity | - | 0.9291 | 92.91% |
UGT catelyzed | + | 0.7000 | 70.00% |
Carcinogenicity (binary) | - | 0.9800 | 98.00% |
Carcinogenicity (trinary) | Non-required | 0.5617 | 56.17% |
Eye corrosion | - | 0.9887 | 98.87% |
Eye irritation | - | 0.9038 | 90.38% |
Skin irritation | - | 0.6481 | 64.81% |
Skin corrosion | - | 0.9390 | 93.90% |
Ames mutagenesis | - | 0.5800 | 58.00% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.5172 | 51.72% |
Micronuclear | - | 0.6400 | 64.00% |
Hepatotoxicity | + | 0.6125 | 61.25% |
skin sensitisation | - | 0.8465 | 84.65% |
Respiratory toxicity | + | 0.7111 | 71.11% |
Reproductive toxicity | + | 0.9000 | 90.00% |
Mitochondrial toxicity | + | 0.7125 | 71.25% |
Nephrotoxicity | + | 0.7826 | 78.26% |
Acute Oral Toxicity (c) | I | 0.4133 | 41.33% |
Estrogen receptor binding | + | 0.7690 | 76.90% |
Androgen receptor binding | + | 0.6936 | 69.36% |
Thyroid receptor binding | - | 0.4934 | 49.34% |
Glucocorticoid receptor binding | + | 0.7945 | 79.45% |
Aromatase binding | + | 0.7412 | 74.12% |
PPAR gamma | + | 0.6981 | 69.81% |
Honey bee toxicity | - | 0.5211 | 52.11% |
Biodegradation | - | 0.7500 | 75.00% |
Crustacea aquatic toxicity | + | 0.5600 | 56.00% |
Fish aquatic toxicity | + | 0.9895 | 98.95% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 |
29.19 nM |
IC50 |
via Super-PRED
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4040 | P28482 | MAP kinase ERK2 | 99.71% | 83.82% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.98% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.87% | 85.14% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.46% | 96.09% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 92.44% | 96.77% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 91.56% | 89.34% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 91.00% | 91.07% |
CHEMBL2581 | P07339 | Cathepsin D | 90.95% | 98.95% |
CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 90.54% | 97.47% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.21% | 94.45% |
CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 89.16% | 95.71% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.75% | 89.00% |
CHEMBL299 | P17252 | Protein kinase C alpha | 88.18% | 98.03% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 87.55% | 96.21% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.14% | 95.56% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 86.47% | 97.28% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.38% | 99.23% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 86.06% | 94.33% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 85.22% | 96.95% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.14% | 91.19% |
CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 84.69% | 90.93% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.36% | 95.89% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 83.71% | 93.03% |
CHEMBL5028 | O14672 | ADAM10 | 83.36% | 97.50% |
CHEMBL2243 | O00519 | Anandamide amidohydrolase | 83.36% | 97.53% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 82.69% | 93.04% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 81.21% | 96.47% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.80% | 97.09% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.55% | 95.50% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 80.54% | 97.79% |
CHEMBL3286 | P00749 | Urokinase-type plasminogen activator | 80.48% | 97.88% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 80.37% | 96.38% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.14% | 97.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 73432 |
NPASS | NPC152301 |
LOTUS | LTS0180340 |
wikiData | Q27105985 |