Bruceantinol
Internal ID | d87b69ad-aa70-4f88-b6d5-b43b2b563e98 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones > Quassinoids |
IUPAC Name | methyl (1R,2S,3R,6R,8R,13S,14R,15R,16S,17S)-3-[(E)-4-acetyloxy-3,4-dimethylpent-2-enoyl]oxy-10,15,16-trihydroxy-9,13-dimethyl-4,11-dioxo-5,18-dioxapentacyclo[12.5.0.01,6.02,17.08,13]nonadec-9-ene-17-carboxylate |
SMILES (Canonical) | CC1=C(C(=O)CC2(C1CC3C45C2C(C(C(C4C(C(=O)O3)OC(=O)C=C(C)C(C)(C)OC(=O)C)(OC5)C(=O)OC)O)O)C)O |
SMILES (Isomeric) | CC1=C(C(=O)C[C@]2([C@H]1C[C@@H]3[C@]45[C@@H]2[C@H]([C@@H]([C@]([C@@H]4[C@H](C(=O)O3)OC(=O)/C=C(\C)/C(C)(C)OC(=O)C)(OC5)C(=O)OC)O)O)C)O |
InChI | InChI=1S/C30H38O13/c1-12(27(4,5)43-14(3)31)8-18(33)42-21-23-29-11-40-30(23,26(38)39-7)24(36)20(35)22(29)28(6)10-16(32)19(34)13(2)15(28)9-17(29)41-25(21)37/h8,15,17,20-24,34-36H,9-11H2,1-7H3/b12-8+/t15-,17+,20+,21+,22+,23+,24-,28-,29+,30-/m0/s1 |
InChI Key | SREUSBYRKOPNJK-AJPRWBMOSA-N |
Popularity | 2 references in papers |
Molecular Formula | C30H38O13 |
Molecular Weight | 606.60 g/mol |
Exact Mass | 606.23124126 g/mol |
Topological Polar Surface Area (TPSA) | 192.00 Ų |
XlogP | 0.80 |
Atomic LogP (AlogP) | 0.84 |
H-Bond Acceptor | 13 |
H-Bond Donor | 3 |
Rotatable Bonds | 5 |
53729-52-5 |
CHEBI:3189 |
C08750 |
methyl (1R,2S,3R,6R,8R,13S,14R,15R,16S,17S)-3-[(E)-4-acetyloxy-3,4-dimethylpent-2-enoyl]oxy-10,15,16-trihydroxy-9,13-dimethyl-4,11-dioxo-5,18-dioxapentacyclo[12.5.0.01,6.02,17.08,13]nonadec-9-ene-17-carboxylate |
Picras-3-en-21-oic acid, 15-[[(2E)-4-(acetyloxy)-3,4-dimethyl-1-oxo-2-penten-1-yl]oxy]-13,20-epoxy-3,11,12-trihydroxy-2,16-dioxo-, methyl ester, (11beta,12alpha,15beta)- |
CHEMBL399894 |
DTXSID70415102 |
HY-N8146 |
AKOS040760307 |
MS-30670 |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9461 | 94.61% |
Caco-2 | - | 0.8334 | 83.34% |
Blood Brain Barrier | - | 0.6750 | 67.50% |
Human oral bioavailability | - | 0.5857 | 58.57% |
Subcellular localzation | Mitochondria | 0.8150 | 81.50% |
OATP2B1 inhibitior | - | 0.7171 | 71.71% |
OATP1B1 inhibitior | + | 0.8496 | 84.96% |
OATP1B3 inhibitior | + | 0.9194 | 91.94% |
MATE1 inhibitior | - | 0.9000 | 90.00% |
OCT2 inhibitior | - | 0.8500 | 85.00% |
BSEP inhibitior | + | 0.9336 | 93.36% |
P-glycoprotein inhibitior | + | 0.7685 | 76.85% |
P-glycoprotein substrate | + | 0.8870 | 88.70% |
CYP3A4 substrate | + | 0.7268 | 72.68% |
CYP2C9 substrate | - | 0.8217 | 82.17% |
CYP2D6 substrate | - | 0.8917 | 89.17% |
CYP3A4 inhibition | - | 0.7852 | 78.52% |
CYP2C9 inhibition | - | 0.7951 | 79.51% |
CYP2C19 inhibition | - | 0.8467 | 84.67% |
CYP2D6 inhibition | - | 0.9413 | 94.13% |
CYP1A2 inhibition | - | 0.8327 | 83.27% |
CYP2C8 inhibition | + | 0.5707 | 57.07% |
CYP inhibitory promiscuity | - | 0.9291 | 92.91% |
UGT catelyzed | + | 0.6000 | 60.00% |
Carcinogenicity (binary) | - | 0.9800 | 98.00% |
Carcinogenicity (trinary) | Non-required | 0.5617 | 56.17% |
Eye corrosion | - | 0.9887 | 98.87% |
Eye irritation | - | 0.9104 | 91.04% |
Skin irritation | - | 0.6481 | 64.81% |
Skin corrosion | - | 0.9390 | 93.90% |
Ames mutagenesis | - | 0.6600 | 66.00% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.5890 | 58.90% |
Micronuclear | - | 0.6400 | 64.00% |
Hepatotoxicity | + | 0.6431 | 64.31% |
skin sensitisation | - | 0.8465 | 84.65% |
Respiratory toxicity | + | 0.7000 | 70.00% |
Reproductive toxicity | + | 0.9000 | 90.00% |
Mitochondrial toxicity | + | 0.7125 | 71.25% |
Nephrotoxicity | + | 0.7588 | 75.88% |
Acute Oral Toxicity (c) | I | 0.4133 | 41.33% |
Estrogen receptor binding | + | 0.7661 | 76.61% |
Androgen receptor binding | + | 0.7255 | 72.55% |
Thyroid receptor binding | + | 0.5527 | 55.27% |
Glucocorticoid receptor binding | + | 0.8163 | 81.63% |
Aromatase binding | + | 0.7518 | 75.18% |
PPAR gamma | + | 0.7085 | 70.85% |
Honey bee toxicity | - | 0.5220 | 52.20% |
Biodegradation | - | 0.8000 | 80.00% |
Crustacea aquatic toxicity | + | 0.6300 | 63.00% |
Fish aquatic toxicity | + | 0.9895 | 98.95% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.34% | 91.11% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 97.71% | 83.82% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.53% | 85.14% |
CHEMBL2581 | P07339 | Cathepsin D | 95.39% | 98.95% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 94.50% | 89.34% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 92.78% | 96.77% |
CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 92.75% | 97.47% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.39% | 96.09% |
CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 91.71% | 90.93% |
CHEMBL299 | P17252 | Protein kinase C alpha | 91.27% | 98.03% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 90.94% | 91.07% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.49% | 94.45% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 90.31% | 96.00% |
CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 89.72% | 95.71% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 88.73% | 97.25% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.40% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.12% | 95.56% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 87.35% | 93.04% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 87.16% | 97.79% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 86.90% | 96.95% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.69% | 95.89% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.95% | 99.23% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 85.82% | 97.28% |
CHEMBL5028 | O14672 | ADAM10 | 85.20% | 97.50% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 84.53% | 91.19% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.23% | 86.33% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 84.05% | 97.14% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 84.02% | 94.33% |
CHEMBL2243 | O00519 | Anandamide amidohydrolase | 83.36% | 97.53% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 82.65% | 98.75% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 82.54% | 89.50% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 81.29% | 93.03% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 81.29% | 97.33% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 81.19% | 96.21% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 80.39% | 96.47% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.30% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 5281305 |
NPASS | NPC194071 |
LOTUS | LTS0191649 |
wikiData | Q27105980 |