Blestriarene B
Internal ID | 82742f16-5fc1-4b49-aba3-2ea464992379 |
Taxonomy | Benzenoids > Phenanthrenes and derivatives > Phenanthrols |
IUPAC Name | 1-(2,7-dihydroxy-4-methoxy-9,10-dihydrophenanthren-1-yl)-4-methoxyphenanthrene-2,7-diol |
SMILES (Canonical) | COC1=C2C(=C(C(=C1)O)C3=C4C=CC5=C(C4=C(C=C3O)OC)C=CC(=C5)O)CCC6=C2C=CC(=C6)O |
SMILES (Isomeric) | COC1=C2C(=C(C(=C1)O)C3=C4C=CC5=C(C4=C(C=C3O)OC)C=CC(=C5)O)CCC6=C2C=CC(=C6)O |
InChI | InChI=1S/C30H24O6/c1-35-25-13-23(33)29(21-7-3-15-11-17(31)5-9-19(15)27(21)25)30-22-8-4-16-12-18(32)6-10-20(16)28(22)26(36-2)14-24(30)34/h3,5-7,9-14,31-34H,4,8H2,1-2H3 |
InChI Key | LCCDZCVHGDFKNQ-UHFFFAOYSA-N |
Popularity | 6 references in papers |
Molecular Formula | C30H24O6 |
Molecular Weight | 480.50 g/mol |
Exact Mass | 480.15728848 g/mol |
Topological Polar Surface Area (TPSA) | 99.40 Ų |
XlogP | 6.50 |
127211-03-4 |
CIRRHOPETALANTHRIN |
1-(2,7-dihydroxy-4-methoxy-9,10-dihydrophenanthren-1-yl)-4-methoxyphenanthrene-2,7-diol |
CHEBI:3141 |
CHEMBL369741 |
[1,1'-Biphenanthrene]-2,2',7,7'-tetrol, 9,10-dihydro-4,4'-dimethoxy-, (-)- |
SCHEMBL1972650 |
DTXSID90331911 |
BDBM50160798 |
D85193 |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.35% | 91.11% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 98.86% | 98.35% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 98.58% | 91.49% |
CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 98.13% | 91.79% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 93.61% | 89.62% |
CHEMBL2535 | P11166 | Glucose transporter | 93.25% | 98.75% |
CHEMBL2581 | P07339 | Cathepsin D | 92.71% | 98.95% |
CHEMBL4208 | P20618 | Proteasome component C5 | 92.09% | 90.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.63% | 94.45% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.01% | 99.17% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 91.01% | 92.94% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.89% | 96.09% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.17% | 94.00% |
CHEMBL2056 | P21728 | Dopamine D1 receptor | 89.53% | 91.00% |
CHEMBL4630 | O14757 | Serine/threonine-protein kinase Chk1 | 88.43% | 97.03% |
CHEMBL1907 | P15144 | Aminopeptidase N | 88.04% | 93.31% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.32% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.54% | 95.56% |
CHEMBL5747 | Q92793 | CREB-binding protein | 85.32% | 95.12% |
CHEMBL344 | Q99705 | Melanin-concentrating hormone receptor 1 | 85.03% | 92.50% |
CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 84.36% | 92.68% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 84.33% | 93.40% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 84.22% | 95.78% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 83.72% | 95.62% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.53% | 95.89% |
CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 82.13% | 95.56% |
CHEMBL3438 | Q05513 | Protein kinase C zeta | 81.75% | 88.48% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 81.08% | 93.99% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 81.06% | 96.21% |
CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 80.62% | 96.67% |
CHEMBL1293289 | P25440 | Bromodomain-containing protein 2 | 80.33% | 86.19% |
CHEMBL3085 | P43003 | Excitatory amino acid transporter 1 | 80.28% | 94.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Bletilla formosana |
Bletilla striata |
Bulbophyllum reptans |
Cremastra appendiculata |
Eriodes barbata |
Gymnadenia conopsea |
Pleione bulbocodioides |
Pleione yunnanensis |
Syzygium aromaticum |
Thunia alba |
PubChem | 442695 |
NPASS | NPC206525 |
ChEMBL | CHEMBL369741 |
LOTUS | LTS0059355 |
wikiData | Q27105951 |