beta-Calacorene
| Internal ID | c859e151-ecdb-43ac-8ee5-2b424d334eed |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
| IUPAC Name | 7-methyl-4-methylidene-1-propan-2-yl-2,3-dihydro-1H-naphthalene |
| SMILES (Canonical) | CC1=CC2=C(C=C1)C(=C)CCC2C(C)C |
| SMILES (Isomeric) | CC1=CC2=C(C=C1)C(=C)CCC2C(C)C |
| InChI | InChI=1S/C15H20/c1-10(2)13-8-6-12(4)14-7-5-11(3)9-15(13)14/h5,7,9-10,13H,4,6,8H2,1-3H3 |
| InChI Key | KFYISTOZYAKAPV-UHFFFAOYSA-N |
| Popularity | 6 references in papers |
| Molecular Formula | C15H20 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.156500638 g/mol |
| Topological Polar Surface Area (TPSA) | 0.00 Ų |
| XlogP | 4.60 |
| 4-Isopropyl-6-methyl-1-methylene-1,2,3,4-tetrahydronaphthalene |
| 50277-34-4 |
| Isopropoxy(isopropyl)dimethylsilane |
| KFYISTOZYAKAPV-UHFFFAOYSA-N |
| DTXSID301037398 |
| 7-methyl-4-methylidene-1-propan-2-yl-2,3-dihydro-1H-naphthalene |
| Q67879717 |
| Naphthalene, 1,2,3,4-tetrahydro-6-methyl-1-methylene-4-(1-methylethyl)- |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 96.84% | 98.95% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 90.27% | 91.49% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 90.25% | 90.71% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.95% | 95.89% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 89.86% | 89.62% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.40% | 95.56% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 89.01% | 93.18% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 88.94% | 93.40% |
| CHEMBL3155 | P34969 | Serotonin 7 (5-HT7) receptor | 88.08% | 90.71% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.33% | 96.09% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 87.20% | 90.24% |
| CHEMBL260 | Q16539 | MAP kinase p38 alpha | 86.29% | 97.78% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 85.78% | 93.56% |
| CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 84.96% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 84.09% | 91.11% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 83.67% | 97.23% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.42% | 100.00% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 83.20% | 99.18% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.94% | 95.89% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 81.80% | 97.25% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 80.24% | 93.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Croton eluteria |
| Cryptomeria japonica |
| Daniellia oliveri |
| Hamamelis virginiana |
| Mastigophora diclados |
| Pilocarpus riedelianus |
| Teucrium polium |
| Teucrium polium subsp. polium |
| PubChem | 529621 |
| LOTUS | LTS0241394 |
| wikiData | Q67879717 |