Atenolol
Internal ID | 9f073cea-3d6c-4b7d-990b-a076c387f89e |
Taxonomy | Benzenoids > Benzene and substituted derivatives > Phenylacetamides |
IUPAC Name | 2-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]acetamide |
SMILES (Canonical) | CC(C)NCC(COC1=CC=C(C=C1)CC(=O)N)O |
SMILES (Isomeric) | CC(C)NCC(COC1=CC=C(C=C1)CC(=O)N)O |
InChI | InChI=1S/C14H22N2O3/c1-10(2)16-8-12(17)9-19-13-5-3-11(4-6-13)7-14(15)18/h3-6,10,12,16-17H,7-9H2,1-2H3,(H2,15,18) |
InChI Key | METKIMKYRPQLGS-UHFFFAOYSA-N |
Popularity | 18,384 references in papers |
Molecular Formula | C14H22N2O3 |
Molecular Weight | 266.34 g/mol |
Exact Mass | 266.16304257 g/mol |
Topological Polar Surface Area (TPSA) | 84.60 Ų |
XlogP | 0.20 |
Atomic LogP (AlogP) | 0.45 |
H-Bond Acceptor | 4 |
H-Bond Donor | 3 |
Rotatable Bonds | 8 |
29122-68-7 |
Tenormin |
Prenormine |
Tenormine |
Blokium |
Myocord |
Normiten |
(RS)-Atenolol |
Duraatenolol |
Betacard |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9936 | 99.36% |
Caco-2 | - | 0.5218 | 52.18% |
Blood Brain Barrier | - | 0.8250 | 82.50% |
Human oral bioavailability | + | 0.6286 | 62.86% |
Subcellular localzation | Mitochondria | 0.8513 | 85.13% |
OATP2B1 inhibitior | - | 1.0000 | 100.00% |
OATP1B1 inhibitior | + | 0.9641 | 96.41% |
OATP1B3 inhibitior | + | 0.9493 | 94.93% |
MATE1 inhibitior | - | 1.0000 | 100.00% |
OCT2 inhibitior | - | 1.0000 | 100.00% |
BSEP inhibitior | - | 0.7905 | 79.05% |
P-glycoprotein inhibitior | - | 0.9348 | 93.48% |
P-glycoprotein substrate | - | 0.9362 | 93.62% |
CYP3A4 substrate | - | 0.6408 | 64.08% |
CYP2C9 substrate | - | 1.0000 | 100.00% |
CYP2D6 substrate | + | 0.4515 | 45.15% |
CYP3A4 inhibition | - | 0.9379 | 93.79% |
CYP2C9 inhibition | - | 0.9163 | 91.63% |
CYP2C19 inhibition | - | 0.9026 | 90.26% |
CYP2D6 inhibition | - | 0.9231 | 92.31% |
CYP1A2 inhibition | - | 0.9045 | 90.45% |
CYP2C8 inhibition | - | 0.9882 | 98.82% |
CYP inhibitory promiscuity | - | 0.9537 | 95.37% |
UGT catelyzed | - | 0.5000 | 50.00% |
Carcinogenicity (binary) | - | 0.8100 | 81.00% |
Carcinogenicity (trinary) | Non-required | 0.7116 | 71.16% |
Eye corrosion | - | 0.9902 | 99.02% |
Eye irritation | - | 0.9897 | 98.97% |
Skin irritation | - | 0.7574 | 75.74% |
Skin corrosion | - | 0.9379 | 93.79% |
Ames mutagenesis | - | 0.9528 | 95.28% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.7260 | 72.60% |
Micronuclear | + | 0.6600 | 66.00% |
Hepatotoxicity | + | 0.6625 | 66.25% |
skin sensitisation | - | 0.8617 | 86.17% |
Respiratory toxicity | + | 0.9889 | 98.89% |
Reproductive toxicity | + | 0.9222 | 92.22% |
Mitochondrial toxicity | + | 0.9125 | 91.25% |
Nephrotoxicity | - | 0.9196 | 91.96% |
Acute Oral Toxicity (c) | III | 0.7976 | 79.76% |
Estrogen receptor binding | - | 0.6595 | 65.95% |
Androgen receptor binding | - | 0.7844 | 78.44% |
Thyroid receptor binding | + | 0.5222 | 52.22% |
Glucocorticoid receptor binding | - | 0.5000 | 50.00% |
Aromatase binding | - | 0.5230 | 52.30% |
PPAR gamma | - | 0.5206 | 52.06% |
Honey bee toxicity | - | 0.9426 | 94.26% |
Biodegradation | - | 0.7750 | 77.50% |
Crustacea aquatic toxicity | - | 0.7950 | 79.50% |
Fish aquatic toxicity | - | 0.8653 | 86.53% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL256 | P0DMS8 | Adenosine A3 receptor |
1.77 nM |
IC50 |
PMID: 16250647
|
CHEMBL213 | P08588 | Beta-1 adrenergic receptor |
1740 nM 1.77 nM 1313 nM 260 nM 210 nM 1640 nM 600 nM |
IC50 IC50 IC50 IC50 IC50 IC50 IC50 |
PMID: 18588282
via Super-PRED via CMAUP PMID: 23466604 PMID: 26988801 PMID: 20875743 PMID: 18983139 |
CHEMBL210 | P07550 | Beta-2 adrenergic receptor |
14634 nM 260 nM |
IC50 Kd |
via CMAUP
via Super-PRED |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit |
39.8 nM |
Potency |
via Super-PRED
|
CHEMBL1293235 | P02545 | Prelamin-A/C |
5 nM 1.6 nM 5 nM |
Potency Potency Potency |
via Super-PRED
via Super-PRED via CMAUP |
CHEMBL1963 | P16473 | Thyroid stimulating hormone receptor |
50.1 nM |
Potency |
via Super-PRED
|
CHEMBL1075138 | Q9NUW8 | Tyrosyl-DNA phosphodiesterase 1 |
70.8 nM 70.8 nM 4 nM |
Potency Potency Potency |
via CMAUP
via Super-PRED via Super-PRED |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 95.51% | 98.95% |
CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 94.88% | 94.00% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 93.83% | 90.17% |
CHEMBL2039 | P27338 | Monoamine oxidase B | 92.82% | 92.51% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.76% | 99.17% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.35% | 94.45% |
CHEMBL4208 | P20618 | Proteasome component C5 | 91.34% | 90.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 89.24% | 94.73% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 89.15% | 95.50% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 88.87% | 91.11% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 88.61% | 89.34% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.70% | 95.89% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 86.74% | 97.29% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.25% | 95.56% |
CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 86.05% | 100.00% |
CHEMBL3902 | P09211 | Glutathione S-transferase Pi | 84.64% | 93.81% |
CHEMBL2535 | P11166 | Glucose transporter | 84.29% | 98.75% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.92% | 96.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.52% | 90.71% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.62% | 94.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Asarum heterotropoides |
Asarum sieboldii |
Myristica fragrans |