[6,7,8,11,12,13,23-Heptahydroxy-3,16-dioxo-21-(3,4,5-trihydroxybenzoyl)oxy-2,17,20-trioxatetracyclo[17.3.1.04,9.010,15]tricosa-4,6,8,10,12,14-hexaen-22-yl] 3,4,5-trihydroxybenzoate
Internal ID | 126e8e21-167a-4e57-9169-20ff2df347f9 |
Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
IUPAC Name | [6,7,8,11,12,13,23-heptahydroxy-3,16-dioxo-21-(3,4,5-trihydroxybenzoyl)oxy-2,17,20-trioxatetracyclo[17.3.1.04,9.010,15]tricosa-4,6,8,10,12,14-hexaen-22-yl] 3,4,5-trihydroxybenzoate |
SMILES (Canonical) | C1C2C(C(C(C(O2)OC(=O)C3=CC(=C(C(=C3)O)O)O)OC(=O)C4=CC(=C(C(=C4)O)O)O)OC(=O)C5=CC(=C(C(=C5C6=C(C(=C(C=C6C(=O)O1)O)O)O)O)O)O)O |
SMILES (Isomeric) | C1C2C(C(C(C(O2)OC(=O)C3=CC(=C(C(=C3)O)O)O)OC(=O)C4=CC(=C(C(=C4)O)O)O)OC(=O)C5=CC(=C(C(=C5C6=C(C(=C(C=C6C(=O)O1)O)O)O)O)O)O)O |
InChI | InChI=1S/C34H26O22/c35-12-1-8(2-13(36)21(12)41)30(48)55-29-28-25(45)18(53-34(29)56-31(49)9-3-14(37)22(42)15(38)4-9)7-52-32(50)10-5-16(39)23(43)26(46)19(10)20-11(33(51)54-28)6-17(40)24(44)27(20)47/h1-6,18,25,28-29,34-47H,7H2 |
InChI Key | LKIUIJRRMWFBBL-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C34H26O22 |
Molecular Weight | 786.60 g/mol |
Exact Mass | 786.09157245 g/mol |
Topological Polar Surface Area (TPSA) | 377.00 Ų |
XlogP | 1.20 |
There are no found synonyms. |
![2D Structure of [6,7,8,11,12,13,23-Heptahydroxy-3,16-dioxo-21-(3,4,5-trihydroxybenzoyl)oxy-2,17,20-trioxatetracyclo[17.3.1.04,9.010,15]tricosa-4,6,8,10,12,14-hexaen-22-yl] 3,4,5-trihydroxybenzoate 2D Structure of [6,7,8,11,12,13,23-Heptahydroxy-3,16-dioxo-21-(3,4,5-trihydroxybenzoyl)oxy-2,17,20-trioxatetracyclo[17.3.1.04,9.010,15]tricosa-4,6,8,10,12,14-hexaen-22-yl] 3,4,5-trihydroxybenzoate](https://plantaedb.com/storage/docs/compounds/2023/11/a8c2d740-864a-11ee-89c7-935133925b91.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.99% | 91.11% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 93.70% | 83.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.85% | 89.00% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 91.35% | 91.49% |
CHEMBL2581 | P07339 | Cathepsin D | 90.24% | 98.95% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.47% | 94.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.97% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.09% | 95.56% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.02% | 95.89% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.31% | 99.17% |
CHEMBL3194 | P02766 | Transthyretin | 85.30% | 90.71% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.18% | 85.14% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.14% | 90.00% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 83.80% | 92.50% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 83.78% | 96.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.51% | 97.09% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.34% | 99.23% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 81.87% | 95.64% |
CHEMBL3401 | O75469 | Pregnane X receptor | 81.72% | 94.73% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 80.98% | 99.15% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.45% | 92.62% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 80.35% | 96.21% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.25% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Excoecaria agallocha |
Mallotus japonicus |
Phyllanthus niruri |
PubChem | 14284662 |
LOTUS | LTS0194639 |
wikiData | Q105153070 |