7,8,9,12,13,14,25,26,27,30,31,32,35,36,37-Pentadecahydroxy-46-(2,3,4,5-tetrahydroxyoxan-2-yl)-3,18,21,41,43-pentaoxanonacyclo[27.13.3.138,42.02,20.05,10.011,16.023,28.033,45.034,39]hexatetraconta-5,7,9,11,13,15,23,25,27,29(45),30,32,34(39),35,37-pentadecaene-4,17,22,40,44-pentone
Internal ID | 75270bef-088f-4230-8eb7-636b96e129ef |
Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
IUPAC Name | 7,8,9,12,13,14,25,26,27,30,31,32,35,36,37-pentadecahydroxy-46-(2,3,4,5-tetrahydroxyoxan-2-yl)-3,18,21,41,43-pentaoxanonacyclo[27.13.3.138,42.02,20.05,10.011,16.023,28.033,45.034,39]hexatetraconta-5,7,9,11,13,15,23,25,27,29(45),30,32,34(39),35,37-pentadecaene-4,17,22,40,44-pentone |
SMILES (Canonical) | C1C(C(C(C(O1)(C2C3C4C5C(COC(=O)C6=CC(=C(C(=C6C7=C(C(=C(C=C7C(=O)O5)O)O)O)O)O)O)OC(=O)C8=CC(=C(C(=C8C9=C(C(=C(C(=C9O)O)O)C1=C(C2=C(C(=C1O)O)O)C(=O)O3)C(=O)O4)O)O)O)O)O)O)O |
SMILES (Isomeric) | C1C(C(C(C(O1)(C2C3C4C5C(COC(=O)C6=CC(=C(C(=C6C7=C(C(=C(C=C7C(=O)O5)O)O)O)O)O)O)OC(=O)C8=CC(=C(C(=C8C9=C(C(=C(C(=C9O)O)O)C1=C(C2=C(C(=C1O)O)O)C(=O)O3)C(=O)O4)O)O)O)O)O)O)O |
InChI | InChI=1S/C46H34O30/c47-9-1-6-14(28(55)24(9)51)15-7(2-10(48)25(52)29(15)56)43(67)74-37-13(5-71-41(6)65)73-42(66)8-3-11(49)26(53)30(57)16(8)17-20-18(32(59)35(62)31(17)58)19-21-22(34(61)36(63)33(19)60)23(38(75-45(21)69)39(37)76-44(20)68)46(70)40(64)27(54)12(50)4-72-46/h1-3,12-13,23,27,37-40,47-64,70H,4-5H2 |
InChI Key | ZVFDKYBWZMATCT-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C46H34O30 |
Molecular Weight | 1066.70 g/mol |
Exact Mass | 1066.11348966 g/mol |
Topological Polar Surface Area (TPSA) | 525.00 Ų |
XlogP | -1.10 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.68% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 95.28% | 91.49% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.60% | 89.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 94.56% | 85.14% |
CHEMBL2581 | P07339 | Cathepsin D | 91.69% | 98.95% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 89.72% | 96.38% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.67% | 94.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.34% | 95.56% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 88.83% | 96.00% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 88.64% | 93.03% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.05% | 100.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.77% | 95.89% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.68% | 99.15% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.60% | 99.23% |
CHEMBL2535 | P11166 | Glucose transporter | 81.96% | 98.75% |
CHEMBL4530 | P00488 | Coagulation factor XIII | 81.24% | 96.00% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 81.18% | 82.69% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 81.07% | 93.40% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.00% | 86.33% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 80.34% | 97.21% |
CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 80.28% | 85.11% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Castanea mollissima |
Lagerstroemia speciosa |
Melaleuca leucadendra |
Psidium guajava |
Quercus alba |
Quercus petraea |
Quercus robur |
Quercus suber |
Syzygium aqueum |
Syzygium grande |
PubChem | 14428075 |
LOTUS | LTS0228955 |
wikiData | Q104390731 |