9,19-Cyclolanost-25-en-3-ol, 24-methyl-, (3beta,24S)-
| Internal ID | 9361c15e-0cdb-4a9a-a496-14bf4c0e87e8 |
| Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Cycloartanols and derivatives |
| IUPAC Name | 15-(5,6-dimethylhept-6-en-2-yl)-7,7,12,16-tetramethylpentacyclo[9.7.0.01,3.03,8.012,16]octadecan-6-ol |
| SMILES (Canonical) | CC(CCC(C)C(=C)C)C1CCC2(C1(CCC34C2CCC5C3(C4)CCC(C5(C)C)O)C)C |
| SMILES (Isomeric) | CC(CCC(C)C(=C)C)C1CCC2(C1(CCC34C2CCC5C3(C4)CCC(C5(C)C)O)C)C |
| InChI | InChI=1S/C31H52O/c1-20(2)21(3)9-10-22(4)23-13-15-29(8)25-12-11-24-27(5,6)26(32)14-16-30(24)19-31(25,30)18-17-28(23,29)7/h21-26,32H,1,9-19H2,2-8H3 |
| InChI Key | IXHACUTUTOCSJE-UHFFFAOYSA-N |
| Popularity | 4 references in papers |
| Molecular Formula | C31H52O |
| Molecular Weight | 440.70 g/mol |
| Exact Mass | 440.401816278 g/mol |
| Topological Polar Surface Area (TPSA) | 20.20 Ų |
| XlogP | 10.40 |
| 9,19-Cyclo-9.beta.-lanost-25-en-3.beta.-ol, 24-methyl-, (24S)- |
| IXHACUTUTOCSJE-UHFFFAOYSA-N |
| 3a,6,6,12a-Tetramethyl-1-(1,4,5-trimethyl-5-hexenyl)tetradecahydro-1H-cyclopenta[a]cyclopropa[e]phenanthren-7-ol # |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.26% | 97.25% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.14% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.67% | 96.09% |
| CHEMBL233 | P35372 | Mu opioid receptor | 91.04% | 97.93% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.85% | 98.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.75% | 94.45% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.20% | 97.09% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 88.22% | 95.58% |
| CHEMBL3837 | P07711 | Cathepsin L | 87.19% | 96.61% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 87.08% | 96.61% |
| CHEMBL240 | Q12809 | HERG | 86.33% | 89.76% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 86.20% | 83.82% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 85.41% | 93.00% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.32% | 100.00% |
| CHEMBL2095194 | P08709 | Coagulation factor VII/tissue factor | 84.29% | 99.17% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 84.29% | 94.75% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 83.97% | 97.79% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 83.88% | 96.95% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 83.37% | 92.86% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.86% | 95.89% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 82.78% | 98.10% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 82.75% | 82.69% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.16% | 100.00% |
| CHEMBL206 | P03372 | Estrogen receptor alpha | 81.23% | 97.64% |
| CHEMBL236 | P41143 | Delta opioid receptor | 80.15% | 99.35% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Crinum asiaticum |
| Cucumis melo |
| Epidendrum rigidum |
| Euphorbia aleppica |
| Euphorbia nivulia |
| Manilkara bidentata |
| Melianthus major |
| Pteris ensiformis |
| Tillandsia fasciculata |
| Turraeanthus africanus |
| Zea mays |
| PubChem | 550205 |
| LOTUS | LTS0091769 |
| wikiData | Q104169228 |