(2R,3S,4R,5R,6S)-2-[(2S,3S,4R,5S,6S)-2-[(1E,5E,10R)-11-[(2R,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-2,6,10-trimethylundeca-1,5-dienoxy]-5-hydroxy-6-(hydroxymethyl)-3-[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-4-yl]oxy-6-methyloxane-3,4,5-triol
Internal ID | 2f12f5dc-da4a-4da5-b0eb-808eaa05f3cd |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Oligosaccharides |
IUPAC Name | (2R,3S,4R,5R,6S)-2-[(2S,3S,4R,5S,6S)-2-[(1E,5E,10R)-11-[(2R,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-2,6,10-trimethylundeca-1,5-dienoxy]-5-hydroxy-6-(hydroxymethyl)-3-[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-4-yl]oxy-6-methyloxane-3,4,5-triol |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(C(OC(C2OC3C(C(C(C(O3)C)O)O)O)OC=C(C)CCC=C(C)CCCC(C)COC4C(C(C(C(O4)CO)O)O)OC5C(C(C(C(O5)C)O)O)O)CO)O)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)O[C@@H]2[C@H]([C@@H](O[C@@H]([C@H]2O[C@@H]3[C@H]([C@@H]([C@H]([C@@H](O3)C)O)O)O)O/C=C(\C)/CC/C=C(\C)/CCC[C@@H](C)CO[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)C)O)O)O)CO)O)O)O)O |
InChI | InChI=1S/C44H76O24/c1-17(9-7-11-18(2)15-59-43-38(33(55)28(50)23(13-45)64-43)67-41-35(57)31(53)26(48)21(5)62-41)10-8-12-19(3)16-60-44-39(68-42-36(58)32(54)27(49)22(6)63-42)37(29(51)24(14-46)65-44)66-40-34(56)30(52)25(47)20(4)61-40/h10,16,18,20-58H,7-9,11-15H2,1-6H3/b17-10+,19-16+/t18-,20+,21-,22+,23-,24+,25+,26-,27+,28-,29+,30-,31+,32-,33+,34+,35-,36+,37-,38-,39+,40-,41+,42-,43-,44+/m1/s1 |
InChI Key | OAEIEZZFMUVSDP-DTXMUUGGSA-N |
Popularity | 0 references in papers |
Molecular Formula | C44H76O24 |
Molecular Weight | 989.10 g/mol |
Exact Mass | 988.47265329 g/mol |
Topological Polar Surface Area (TPSA) | 376.00 Ų |
XlogP | -2.60 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.77% | 91.11% |
CHEMBL3401 | O75469 | Pregnane X receptor | 93.68% | 94.73% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.07% | 96.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.33% | 99.17% |
CHEMBL2581 | P07339 | Cathepsin D | 91.55% | 98.95% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 89.22% | 96.47% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 88.86% | 97.36% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.90% | 96.00% |
CHEMBL4683 | Q12884 | Fibroblast activation protein alpha | 84.98% | 93.07% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.96% | 89.00% |
CHEMBL2094135 | Q96BI3 | Gamma-secretase | 84.90% | 98.05% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 84.80% | 95.58% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 84.43% | 97.29% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 83.63% | 95.93% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 83.34% | 93.56% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.51% | 95.89% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.18% | 90.71% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 81.83% | 98.75% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 81.06% | 92.86% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 80.98% | 97.25% |
CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 80.50% | 92.32% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 80.29% | 91.24% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Diospyros kaki |
Mangifera indica |
Panzerina lanata |
Pittosporum tobira |
Sapindus mukorossi |
PubChem | 162941191 |
LOTUS | LTS0086202 |
wikiData | Q3347162 |