[(1R,2S,5R,6R,13S,14R,16S)-6-(furan-3-yl)-16-(2-methoxy-2-oxoethyl)-1,5,15,15-tetramethyl-8,17-dioxo-7-oxatetracyclo[11.3.1.02,11.05,10]heptadec-10-en-14-yl] (E)-2-methylbut-2-enoate
Internal ID | 4db243f3-bc1b-47ab-a399-8c6ccf51fda3 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids > Limonoids |
IUPAC Name | [(1R,2S,5R,6R,13S,14R,16S)-6-(furan-3-yl)-16-(2-methoxy-2-oxoethyl)-1,5,15,15-tetramethyl-8,17-dioxo-7-oxatetracyclo[11.3.1.02,11.05,10]heptadec-10-en-14-yl] (E)-2-methylbut-2-enoate |
SMILES (Canonical) | CC=C(C)C(=O)OC1C2CC3=C4CC(=O)OC(C4(CCC3C(C2=O)(C(C1(C)C)CC(=O)OC)C)C)C5=COC=C5 |
SMILES (Isomeric) | C/C=C(\C)/C(=O)O[C@@H]1[C@@H]2CC3=C4CC(=O)O[C@H]([C@@]4(CC[C@@H]3[C@@](C2=O)([C@H](C1(C)C)CC(=O)OC)C)C)C5=COC=C5 |
InChI | InChI=1S/C32H40O8/c1-8-17(2)29(36)40-28-20-13-19-21(32(6,26(20)35)23(30(28,3)4)15-24(33)37-7)9-11-31(5)22(19)14-25(34)39-27(31)18-10-12-38-16-18/h8,10,12,16,20-21,23,27-28H,9,11,13-15H2,1-7H3/b17-8+/t20-,21+,23+,27+,28-,31-,32-/m1/s1 |
InChI Key | LWYAUKBIVFFRJL-AECCWTEBSA-N |
Popularity | 0 references in papers |
Molecular Formula | C32H40O8 |
Molecular Weight | 552.70 g/mol |
Exact Mass | 552.27231823 g/mol |
Topological Polar Surface Area (TPSA) | 109.00 Ų |
XlogP | 4.00 |
There are no found synonyms. |
![2D Structure of [(1R,2S,5R,6R,13S,14R,16S)-6-(furan-3-yl)-16-(2-methoxy-2-oxoethyl)-1,5,15,15-tetramethyl-8,17-dioxo-7-oxatetracyclo[11.3.1.02,11.05,10]heptadec-10-en-14-yl] (E)-2-methylbut-2-enoate 2D Structure of [(1R,2S,5R,6R,13S,14R,16S)-6-(furan-3-yl)-16-(2-methoxy-2-oxoethyl)-1,5,15,15-tetramethyl-8,17-dioxo-7-oxatetracyclo[11.3.1.02,11.05,10]heptadec-10-en-14-yl] (E)-2-methylbut-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/8a58de70-83ae-11ee-8b02-0dafacfa1e0a.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.91% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.99% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.73% | 96.09% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 91.75% | 91.24% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 90.40% | 83.82% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 90.24% | 90.17% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 89.35% | 94.33% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.33% | 86.33% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.27% | 95.89% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.71% | 97.09% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.85% | 99.23% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.13% | 89.00% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 86.83% | 93.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.75% | 95.56% |
CHEMBL2243 | O00519 | Anandamide amidohydrolase | 84.72% | 97.53% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.72% | 100.00% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 83.63% | 100.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 83.02% | 92.62% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.41% | 94.73% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.74% | 91.19% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 80.95% | 92.88% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 80.93% | 91.07% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cipadessa baccifera |
Khaya anthotheca |
Swietenia macrophylla |
Swietenia mahagoni |
Toona ciliata |
Xylocarpus granatum |
PubChem | 12304849 |
LOTUS | LTS0136840 |
wikiData | Q105158658 |