(2R,3R,4S,5R,6S)-2-[[(2R,3S,4R,5R,6S)-6-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxychromenylium-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methoxy]-6-methyloxane-3,4,5-triol
Internal ID | 237555a0-141d-45fc-acbd-e7d5e09d5fd6 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Anthocyanins > Anthocyanidin-3-O-glycosides |
IUPAC Name | (2R,3R,4S,5R,6S)-2-[[(2R,3S,4R,5R,6S)-6-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxychromenylium-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methoxy]-6-methyloxane-3,4,5-triol |
SMILES (Canonical) | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3=CC4=C(C=C(C=C4[O+]=C3C5=CC(=C(C=C5)O)O)O)O)O)O)O)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@@H]([C@H]([C@@H](O1)OC[C@@H]2[C@H]([C@H]([C@H]([C@@H](O2)OC3=CC4=C(C=C(C=C4[O+]=C3C5=CC(=C(C=C5)O)O)O)O)O)O)O)O)O)O |
InChI | InChI=1S/C27H30O15/c1-9-19(32)21(34)23(36)26(39-9)38-8-18-20(33)22(35)24(37)27(42-18)41-17-7-12-14(30)5-11(28)6-16(12)40-25(17)10-2-3-13(29)15(31)4-10/h2-7,9,18-24,26-27,32-37H,8H2,1H3,(H3-,28,29,30,31)/p+1/t9-,18+,19-,20+,21-,22+,23+,24+,26+,27+/m0/s1 |
InChI Key | USNPULRDBDVJAO-YRBSALHSSA-O |
Popularity | 0 references in papers |
Molecular Formula | C27H31O15+ |
Molecular Weight | 595.50 g/mol |
Exact Mass | 595.16629528 g/mol |
Topological Polar Surface Area (TPSA) | 240.00 Ų |
XlogP | 0.00 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.36% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 99.19% | 91.49% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.30% | 96.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.98% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.46% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 94.01% | 98.95% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 93.05% | 99.15% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.62% | 94.00% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 89.70% | 97.36% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 88.25% | 89.62% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 87.54% | 95.78% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.18% | 99.17% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.58% | 94.73% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 84.45% | 95.93% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 83.52% | 92.94% |
CHEMBL3194 | P02766 | Transthyretin | 82.71% | 90.71% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 82.31% | 86.92% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 81.84% | 95.83% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 81.56% | 94.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Acer palmatum |
Asparagus officinalis |
Cornus suecica |
Dracula chimaera |
Euterpe edulis |
Linum grandiflorum |
Litchi chinensis |
Lonicera caerulea |
Pennisetum setaceum |
Petunia exserta |
Tricyrtis formosana |
PubChem | 154496406 |
LOTUS | LTS0102626 |
wikiData | Q105278371 |