(1S,11S,13S,15S,18S)-15-methoxy-5,7-dioxa-12-azapentacyclo[10.5.2.01,13.02,10.04,8]nonadeca-2,4(8),9,16-tetraene-11,18-diol
Internal ID | 558ef474-b472-4c9d-872b-e935744f7a6e |
Taxonomy | Alkaloids and derivatives > Amaryllidaceae alkaloids > Crinine- and Haemanthamine-type amaryllidaceae alkaloids |
IUPAC Name | (1S,11S,13S,15S,18S)-15-methoxy-5,7-dioxa-12-azapentacyclo[10.5.2.01,13.02,10.04,8]nonadeca-2,4(8),9,16-tetraene-11,18-diol |
SMILES (Canonical) | COC1CC2C3(C=C1)C(CN2C(C4=CC5=C(C=C34)OCO5)O)O |
SMILES (Isomeric) | CO[C@H]1C[C@H]2[C@@]3(C=C1)[C@@H](CN2[C@H](C4=CC5=C(C=C34)OCO5)O)O |
InChI | InChI=1S/C17H19NO5/c1-21-9-2-3-17-11-6-13-12(22-8-23-13)5-10(11)16(20)18(7-15(17)19)14(17)4-9/h2-3,5-6,9,14-16,19-20H,4,7-8H2,1H3/t9-,14+,15-,16+,17+/m1/s1 |
InChI Key | ZSTPNQLNQBRLQF-GKSQQYPGSA-N |
Popularity | 0 references in papers |
Molecular Formula | C17H19NO5 |
Molecular Weight | 317.34 g/mol |
Exact Mass | 317.12632271 g/mol |
Topological Polar Surface Area (TPSA) | 71.40 Ų |
XlogP | 0.70 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 98.49% | 96.77% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.67% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.50% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.01% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.40% | 85.14% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.89% | 97.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.60% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.63% | 89.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 84.81% | 92.62% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.70% | 90.00% |
CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 84.09% | 82.67% |
CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 83.52% | 82.38% |
CHEMBL2581 | P07339 | Cathepsin D | 82.91% | 98.95% |
CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 82.41% | 90.24% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.44% | 95.89% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.42% | 90.71% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.00% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 154496716 |
LOTUS | LTS0043002 |
wikiData | Q105382708 |