7-methoxy-9H-carbazole-3-carbaldehyde
| Internal ID | 99f77f0b-6275-4a5a-9c23-268fc77cebc1 |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Carbazoles |
| IUPAC Name | 7-methoxy-9H-carbazole-3-carbaldehyde |
| SMILES (Canonical) | COC1=CC2=C(C=C1)C3=C(N2)C=CC(=C3)C=O |
| SMILES (Isomeric) | COC1=CC2=C(C=C1)C3=C(N2)C=CC(=C3)C=O |
| InChI | InChI=1S/C14H11NO2/c1-17-10-3-4-11-12-6-9(8-16)2-5-13(12)15-14(11)7-10/h2-8,15H,1H3 |
| InChI Key | IBDBRUPJUXYODT-UHFFFAOYSA-N |
| Popularity | 5 references in papers |
| Molecular Formula | C14H11NO2 |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.078978594 g/mol |
| Topological Polar Surface Area (TPSA) | 42.10 Ų |
| XlogP | 2.80 |
| Clauszoline-K |
| 7-methoxy-9H-carbazole-3-carbaldehyde |
| CHEMBL1927326 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1951 | P21397 | Monoamine oxidase A | 98.55% | 91.49% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 97.75% | 95.56% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.34% | 94.45% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.91% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.89% | 96.09% |
| CHEMBL2292 | Q13627 | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | 90.67% | 93.24% |
| CHEMBL2535 | P11166 | Glucose transporter | 87.25% | 98.75% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 87.07% | 96.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 86.93% | 90.00% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 86.48% | 91.71% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 86.08% | 86.92% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 84.14% | 85.30% |
| CHEMBL1868 | P17948 | Vascular endothelial growth factor receptor 1 | 82.64% | 96.47% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 81.76% | 93.31% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| PubChem | 10537169 |
| NPASS | NPC249583 |
| ChEMBL | CHEMBL1927326 |
| LOTUS | LTS0189900 |
| wikiData | Q105036434 |