7-(3,7-Dimethylocta-2,6-dienoxy)-6-methoxychromen-2-one
Internal ID | bec3267e-e399-4951-8ce9-677373670e65 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones |
IUPAC Name | 7-(3,7-dimethylocta-2,6-dienoxy)-6-methoxychromen-2-one |
SMILES (Canonical) | CC(=CCCC(=CCOC1=C(C=C2C=CC(=O)OC2=C1)OC)C)C |
SMILES (Isomeric) | CC(=CCCC(=CCOC1=C(C=C2C=CC(=O)OC2=C1)OC)C)C |
InChI | InChI=1S/C20H24O4/c1-14(2)6-5-7-15(3)10-11-23-19-13-17-16(12-18(19)22-4)8-9-20(21)24-17/h6,8-10,12-13H,5,7,11H2,1-4H3 |
InChI Key | NLNMITFNBJXRRP-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H24O4 |
Molecular Weight | 328.40 g/mol |
Exact Mass | 328.16745924 g/mol |
Topological Polar Surface Area (TPSA) | 44.80 Ų |
XlogP | 5.20 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.56% | 91.11% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.42% | 99.17% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 93.18% | 92.08% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.42% | 94.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 91.05% | 94.73% |
CHEMBL2581 | P07339 | Cathepsin D | 90.66% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.38% | 86.33% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 87.70% | 96.00% |
CHEMBL4208 | P20618 | Proteasome component C5 | 85.76% | 90.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.09% | 94.45% |
CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 84.57% | 94.03% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.24% | 96.09% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.23% | 90.71% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.22% | 95.56% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.67% | 96.95% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 80.21% | 90.24% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Atalantia buxifolia |
Citrus japonica |
Haplopappus deserticola |
Mikania congesta |
Murraya koenigii |
Murraya paniculata |
Thapsia transtagana |
Thapsia villosa |
Zanthoxylum schinifolium |
PubChem | 54117740 |
LOTUS | LTS0247028 |
wikiData | Q105181465 |