(14aS,26aR)-2,3,13,14,14a,15,26,26a-Octahydro-22,30-dimethoxy-14-methyl-1H-4,6:16,19-dietheno-21,25-metheno-12H-[1,3]dioxolo[4,5-g]pyrido[2 inverted exclamation marka,3 inverted exclamation marka:17,18][1,10]dioxacycloeicosino[2,3,4-ij]isoquinoline
Internal ID | 71a2b653-6cca-4705-8a90-b6b47661c828 |
Taxonomy | Lignans, neolignans and related compounds |
IUPAC Name | (14S,27R)-22,33-dimethoxy-28-methyl-2,5,7,20-tetraoxa-13,28-diazaoctacyclo[25.6.2.216,19.13,10.121,25.04,8.031,35.014,39]nonatriaconta-1(33),3(39),4(8),9,16(38),17,19(37),21,23,25(36),31,34-dodecaene |
SMILES (Canonical) | CN1CCC2=CC(=C3C=C2C1CC4=CC(=C(C=C4)OC)OC5=CC=C(CC6C7=C(O3)C8=C(C=C7CCN6)OCO8)C=C5)OC |
SMILES (Isomeric) | CN1CCC2=CC(=C3C=C2[C@H]1CC4=CC(=C(C=C4)OC)OC5=CC=C(C[C@H]6C7=C(O3)C8=C(C=C7CCN6)OCO8)C=C5)OC |
InChI | InChI=1S/C36H36N2O6/c1-38-13-11-23-17-30(40-3)32-19-26(23)28(38)15-22-6-9-29(39-2)31(16-22)43-25-7-4-21(5-8-25)14-27-34-24(10-12-37-27)18-33-35(36(34)44-32)42-20-41-33/h4-9,16-19,27-28,37H,10-15,20H2,1-3H3/t27-,28+/m0/s1 |
InChI Key | YDDGBJGRSLHCOE-WUFINQPMSA-N |
Popularity | 0 references in papers |
Molecular Formula | C36H36N2O6 |
Molecular Weight | 592.70 g/mol |
Exact Mass | 592.25733687 g/mol |
Topological Polar Surface Area (TPSA) | 70.60 Ų |
XlogP | 6.10 |
Atomic LogP (AlogP) | 6.53 |
H-Bond Acceptor | 8 |
H-Bond Donor | 1 |
Rotatable Bonds | 2 |
123854-64-8 |
N2-Demethylcepharanthine |
![2D Structure of (14aS,26aR)-2,3,13,14,14a,15,26,26a-Octahydro-22,30-dimethoxy-14-methyl-1H-4,6:16,19-dietheno-21,25-metheno-12H-[1,3]dioxolo[4,5-g]pyrido[2 inverted exclamation marka,3 inverted exclamation marka:17,18][1,10]dioxacycloeicosino[2,3,4-ij]isoquinoline 2D Structure of (14aS,26aR)-2,3,13,14,14a,15,26,26a-Octahydro-22,30-dimethoxy-14-methyl-1H-4,6:16,19-dietheno-21,25-metheno-12H-[1,3]dioxolo[4,5-g]pyrido[2 inverted exclamation marka,3 inverted exclamation marka:17,18][1,10]dioxacycloeicosino[2,3,4-ij]isoquinoline](https://plantaedb.com/storage/docs/compounds/2023/07/6c947760-234e-11ee-9783-df63ff52f9b8.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9396 | 93.96% |
Caco-2 | + | 0.7823 | 78.23% |
Blood Brain Barrier | + | 0.9000 | 90.00% |
Human oral bioavailability | - | 0.6857 | 68.57% |
Subcellular localzation | Lysosomes | 0.8322 | 83.22% |
OATP2B1 inhibitior | - | 0.8582 | 85.82% |
OATP1B1 inhibitior | + | 0.9272 | 92.72% |
OATP1B3 inhibitior | + | 0.9387 | 93.87% |
MATE1 inhibitior | - | 0.8200 | 82.00% |
OCT2 inhibitior | - | 0.6250 | 62.50% |
BSEP inhibitior | + | 1.0000 | 100.00% |
P-glycoprotein inhibitior | + | 0.9708 | 97.08% |
P-glycoprotein substrate | + | 0.7130 | 71.30% |
CYP3A4 substrate | + | 0.6811 | 68.11% |
CYP2C9 substrate | - | 0.8100 | 81.00% |
CYP2D6 substrate | + | 0.6036 | 60.36% |
CYP3A4 inhibition | - | 0.8674 | 86.74% |
CYP2C9 inhibition | - | 0.8686 | 86.86% |
CYP2C19 inhibition | - | 0.8442 | 84.42% |
CYP2D6 inhibition | - | 0.6950 | 69.50% |
CYP1A2 inhibition | - | 0.7570 | 75.70% |
CYP2C8 inhibition | + | 0.5233 | 52.33% |
CYP inhibitory promiscuity | - | 0.8012 | 80.12% |
UGT catelyzed | - | 0.0000 | 0.00% |
Carcinogenicity (binary) | - | 0.9700 | 97.00% |
Carcinogenicity (trinary) | Non-required | 0.6297 | 62.97% |
Eye corrosion | - | 0.9858 | 98.58% |
Eye irritation | - | 0.9601 | 96.01% |
Skin irritation | - | 0.7693 | 76.93% |
Skin corrosion | - | 0.9405 | 94.05% |
Ames mutagenesis | + | 0.8700 | 87.00% |
Human Ether-a-go-go-Related Gene inhibition | + | 0.9378 | 93.78% |
Micronuclear | + | 0.5600 | 56.00% |
Hepatotoxicity | - | 0.9250 | 92.50% |
skin sensitisation | - | 0.8702 | 87.02% |
Respiratory toxicity | + | 0.7889 | 78.89% |
Reproductive toxicity | + | 0.9444 | 94.44% |
Mitochondrial toxicity | + | 0.8500 | 85.00% |
Nephrotoxicity | - | 0.6535 | 65.35% |
Acute Oral Toxicity (c) | III | 0.6279 | 62.79% |
Estrogen receptor binding | + | 0.7298 | 72.98% |
Androgen receptor binding | + | 0.7193 | 71.93% |
Thyroid receptor binding | + | 0.6596 | 65.96% |
Glucocorticoid receptor binding | + | 0.8617 | 86.17% |
Aromatase binding | + | 0.5356 | 53.56% |
PPAR gamma | + | 0.6679 | 66.79% |
Honey bee toxicity | - | 0.6653 | 66.53% |
Biodegradation | - | 0.8250 | 82.50% |
Crustacea aquatic toxicity | + | 0.5500 | 55.00% |
Fish aquatic toxicity | + | 0.7966 | 79.66% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.29% | 96.09% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 96.76% | 96.77% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 96.44% | 93.99% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.71% | 94.45% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 93.76% | 89.62% |
CHEMBL2056 | P21728 | Dopamine D1 receptor | 92.35% | 91.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.42% | 85.14% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.63% | 95.89% |
CHEMBL4895 | P30530 | Tyrosine-protein kinase receptor UFO | 90.30% | 90.95% |
CHEMBL2581 | P07339 | Cathepsin D | 89.85% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.98% | 97.09% |
CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 86.16% | 97.31% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.76% | 95.56% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 85.30% | 95.78% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 85.20% | 92.62% |
CHEMBL2535 | P11166 | Glucose transporter | 84.85% | 98.75% |
CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 84.45% | 96.09% |
CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 84.11% | 82.38% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 83.70% | 91.03% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 83.38% | 89.50% |
CHEMBL5925 | P22413 | Ectonucleotide pyrophosphatase/phosphodiesterase family member 1 | 83.32% | 92.38% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.21% | 86.33% |
CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 82.64% | 82.67% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 82.43% | 93.40% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 82.35% | 97.25% |
CHEMBL4247 | Q9UM73 | ALK tyrosine kinase receptor | 82.20% | 96.86% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.61% | 94.00% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 81.35% | 95.62% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.81% | 95.89% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 80.22% | 100.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.20% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ardisia crispa |
Doronicum grandiflorum |
Leibnitzia anandria |
Lithocarpus haipinii |
Oxytropis lanata |
Populus balsamifera |
Sphaerophysa salsula |
Stephania pierrei |
Stephania suberosa |
Strychnos gossweileri |
PubChem | 14488278 |
NPASS | NPC123331 |
LOTUS | LTS0005308 |
wikiData | Q105346681 |